Diethyl ((E)-3-([1,1'-biphenyl]-4-yl)acryloyl)glycyl-L-valyl-D-glutamate

ID: ALA5191166

PubChem CID: 168284499

Max Phase: Preclinical

Molecular Formula: C31H39N3O7

Molecular Weight: 565.67

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCOC(=O)CC[C@@H](NC(=O)[C@@H](NC(=O)CNC(=O)/C=C/c1ccc(-c2ccccc2)cc1)C(C)C)C(=O)OCC

Standard InChI:  InChI=1S/C31H39N3O7/c1-5-40-28(37)19-17-25(31(39)41-6-2)33-30(38)29(21(3)4)34-27(36)20-32-26(35)18-14-22-12-15-24(16-13-22)23-10-8-7-9-11-23/h7-16,18,21,25,29H,5-6,17,19-20H2,1-4H3,(H,32,35)(H,33,38)(H,34,36)/b18-14+/t25-,29+/m1/s1

Standard InChI Key:  DJHNKWYSDYXLDP-NWSQRCGVSA-N

Molfile:  

 
     RDKit          2D

 41 42  0  0  0  0  0  0  0  0999 V2000
   -2.1657   -0.1697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4513    0.2428    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1657   -0.9949    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8804    0.2429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5952   -0.1697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3099    0.2429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0247   -0.1694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7369    0.2425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7369    1.0680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0265    1.4800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3099    1.0717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4516    1.4806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7365   -0.1697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0218    0.2428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6927   -0.1697    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0218    1.0681    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4075    0.2428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1222   -0.1697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4075    1.0681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8368    0.2428    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1222   -0.9950    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5516   -0.1697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2663    0.2428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9809   -0.1697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6957    0.2428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4104   -0.1697    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1251    0.2428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5516   -0.9950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2663   -1.4076    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8368   -1.4076    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2663   -2.2329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5989   -2.7177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8786   -0.0926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6957    1.0681    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1222    1.4807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6927    1.4807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1665    1.0682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8786    1.4803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8786    2.3058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1683    2.7177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4516    2.3095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  2  0
  1  4  1  0
  4  5  2  0
  5  6  1  0
  7  6  2  0
  8  7  1  0
  9  8  2  0
 10  9  1  0
 11 10  2  0
  6 11  1  0
  9 12  1  0
  2 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  2  0
 15 17  1  0
 17 18  1  0
 17 19  1  1
 18 20  1  0
 18 21  2  0
 20 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 22 28  1  6
 28 29  1  0
 28 30  2  0
 29 31  1  0
 32 31  1  0
 33 27  1  0
 25 34  2  0
 35 19  1  0
 19 36  1  0
 37 12  2  0
 38 37  1  0
 39 38  2  0
 40 39  1  0
 41 40  2  0
 12 41  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5191166

    ---

Associated Targets(Human)

NOD2 Tclin Nucleotide-binding oligomerization domain-containing protein 2 (1613 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
NOD1 Tchem Nucleotide-binding oligomerization domain-containing protein 1 (1322 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 565.67Molecular Weight (Monoisotopic): 565.2788AlogP: 3.02#Rotatable Bonds: 15
Polar Surface Area: 139.90Molecular Species: NEUTRALHBA: 7HBD: 3
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.95CX Basic pKa: CX LogP: 3.14CX LogD: 3.14
Aromatic Rings: 2Heavy Atoms: 41QED Weighted: 0.22Np Likeness Score: -0.33

References

1. Guzelj S, Bizjak Š, Jakopin Ž..  (2022)  Discovery of Desmuramylpeptide NOD2 Agonists with Single-Digit Nanomolar Potency.,  13  (8.0): [PMID:35978688] [10.1021/acsmedchemlett.2c00121]

Source