The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Nostosin G ID: ALA5191296
PubChem CID: 164887574
Max Phase: Preclinical
Molecular Formula: C25H33N5O6
Molecular Weight: 499.57
Associated Items:
Names and Identifiers Canonical SMILES: N=C(N)NCCC[C@@H](C=O)NC(=O)[C@H](CCc1ccc(O)cc1)NC(=O)[C@H](O)Cc1ccc(O)cc1
Standard InChI: InChI=1S/C25H33N5O6/c26-25(27)28-13-1-2-18(15-31)29-23(35)21(12-7-16-3-8-19(32)9-4-16)30-24(36)22(34)14-17-5-10-20(33)11-6-17/h3-6,8-11,15,18,21-22,32-34H,1-2,7,12-14H2,(H,29,35)(H,30,36)(H4,26,27,28)/t18-,21-,22+/m0/s1
Standard InChI Key: XZGYPANYOCFBHU-YUXAGFNASA-N
Molfile:
RDKit 2D
36 37 0 0 0 0 0 0 0 0999 V2000
-4.6437 2.6804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9291 3.0927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2172 2.6807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2172 1.8556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9273 1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6437 1.8519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5026 1.4430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7879 1.8556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0733 1.4430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7879 2.6807 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3587 1.8556 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0733 0.6178 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.3559 1.4430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0705 1.8556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3559 0.6178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0705 0.2052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0705 -0.6199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7851 -1.0327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7843 -1.8554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0695 -2.2681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3576 -1.8590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3528 -1.0343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0705 2.6807 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7851 1.4430 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4998 1.8556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2144 1.4430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4998 2.6807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2144 3.0934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9290 2.6807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9290 1.8556 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.6437 1.4430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6437 0.6178 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3583 1.8556 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2144 0.6178 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.3583 3.0929 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0695 -3.0934 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
4 7 1 0
7 8 1 0
8 9 1 0
8 10 1 1
9 11 1 0
9 12 2 0
11 13 1 0
13 14 1 0
13 15 1 6
15 16 1 0
16 17 1 0
18 17 2 0
19 18 1 0
20 19 2 0
21 20 1 0
22 21 2 0
17 22 1 0
14 23 2 0
14 24 1 0
24 25 1 0
25 26 1 0
25 27 1 1
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
31 33 2 0
26 34 2 0
1 35 1 0
20 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 499.57Molecular Weight (Monoisotopic): 499.2431AlogP: 0.07#Rotatable Bonds: 14Polar Surface Area: 197.86Molecular Species: BASEHBA: 7HBD: 8#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 9#RO5 Violations (Lipinski): 2CX Acidic pKa: 9.20CX Basic pKa: 11.88CX LogP: -0.25CX LogD: -1.43Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.08Np Likeness Score: 0.97
References 1. Phan CS, Mehjabin JJ, Anas ARJ, Hayasaka M, Onoki R, Wang J, Umezawa T, Washio K, Morikawa M, Okino T.. (2022) Nostosin G and Spiroidesin B from the Cyanobacterium Dolichospermum sp. NIES-1697., 85 (8.0): [PMID:35948062 ] [10.1021/acs.jnatprod.2c00382 ]