The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Methyl ((4-(4-((2-ethyl-5,7-dimethyl-3H-imidazo[4,5-b]pyridin-3-yl)methyl)phenyl)-2-propylthiazol-5-yl)sulfonyl)carbamate ID: ALA5191326
PubChem CID: 168289415
Max Phase: Preclinical
Molecular Formula: C25H29N5O4S2
Molecular Weight: 527.67
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCc1nc(-c2ccc(Cn3c(CC)nc4c(C)cc(C)nc43)cc2)c(S(=O)(=O)NC(=O)OC)s1
Standard InChI: InChI=1S/C25H29N5O4S2/c1-6-8-20-28-22(24(35-20)36(32,33)29-25(31)34-5)18-11-9-17(10-12-18)14-30-19(7-2)27-21-15(3)13-16(4)26-23(21)30/h9-13H,6-8,14H2,1-5H3,(H,29,31)
Standard InChI Key: NTPPXKUWVLDJKC-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
-0.6002 -2.5447 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-1.4253 -2.5494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9064 -3.2195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7273 -3.1381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2084 -3.8083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6848 -1.7663 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0202 -1.2776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0249 -0.4526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7417 -0.0442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7465 0.7806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0344 1.1973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0391 2.0223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3271 2.4389 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.2455 3.2597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8618 3.8083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6450 3.5488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5602 3.4360 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.9769 2.7239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4284 2.1076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6879 1.3246 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4958 1.1577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0442 1.7739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7848 2.5571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3333 3.1732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7553 0.3746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3176 0.7888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3128 -0.0359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3499 -1.7586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4471 -1.5451 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.0306 -2.1286 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8278 -1.9150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4113 -2.4985 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0414 -1.1178 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2084 -2.2849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8605 -0.8291 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0345 -0.8291 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
2 6 2 0
6 7 1 0
7 8 1 0
9 8 2 0
10 9 1 0
11 10 2 0
11 12 1 0
12 13 1 0
14 13 1 0
14 15 1 0
15 16 1 0
14 17 2 0
17 18 1 0
18 19 2 0
19 13 1 0
19 20 1 0
20 21 2 0
21 22 1 0
18 23 1 0
22 23 2 0
23 24 1 0
21 25 1 0
26 11 1 0
27 26 2 0
8 27 1 0
7 28 2 0
28 1 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
31 33 2 0
32 34 1 0
29 35 2 0
29 36 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 527.67Molecular Weight (Monoisotopic): 527.1661AlogP: 4.78#Rotatable Bonds: 8Polar Surface Area: 116.07Molecular Species: ACIDHBA: 9HBD: 1#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 4.61CX Basic pKa: 3.42CX LogP: 4.97CX LogD: 4.23Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.35Np Likeness Score: -1.45
References 1. Gopalan G, Palo-Nieto C, Petersen NN, Hallberg M, Larhed M.. (2022) Angiotensin II AT2 receptor ligands with phenylthiazole scaffolds., 65 [PMID:35550979 ] [10.1016/j.bmc.2022.116790 ]