The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-8-amino-5-(3-fluoro-4-((2-methylpyrrolidin-1-yl)methyl)phenyl)-2-(4-hydroxycyclohexyl)-3,4-dihydro-2,7-naphthyridin-1(2H)-one ID: ALA5191364
PubChem CID: 168284508
Max Phase: Preclinical
Molecular Formula: C26H33FN4O2
Molecular Weight: 452.57
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C[C@@H]1CCCN1Cc1ccc(-c2cnc(N)c3c2CCN(C2CCC(O)CC2)C3=O)cc1F
Standard InChI: InChI=1S/C26H33FN4O2/c1-16-3-2-11-30(16)15-18-5-4-17(13-23(18)27)22-14-29-25(28)24-21(22)10-12-31(26(24)33)19-6-8-20(32)9-7-19/h4-5,13-14,16,19-20,32H,2-3,6-12,15H2,1H3,(H2,28,29)/t16-,19?,20?/m1/s1
Standard InChI Key: QIGLCSOIUAUGES-PBPGXSGUSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
-3.2267 1.6339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9411 1.2215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9411 0.3965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2267 -0.0159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5121 0.3965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5121 1.2215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7976 -0.0159 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0832 0.3965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3687 -0.0159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3687 -0.8409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0832 -1.2535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0832 -2.0785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3687 -2.4910 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.3458 -2.0785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3458 -1.2535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0602 -0.8409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0602 -0.0159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7747 0.3965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7747 1.2215 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.4892 -0.0159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2037 0.3965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2037 1.2215 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5362 1.7065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7912 2.4910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6162 2.4910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8712 1.7064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6558 1.4515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4892 -0.8409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7747 -1.2535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7976 -2.4910 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.7976 -0.8409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5121 -1.2535 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.6558 1.6341 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 1 1 0
5 7 1 0
7 8 1 0
9 8 1 0
10 9 1 0
11 10 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
10 15 1 0
16 15 1 0
17 16 2 0
18 17 1 0
18 19 1 0
20 18 2 0
20 21 1 0
21 22 1 0
23 22 1 0
23 24 1 0
24 25 1 0
26 25 1 0
22 26 1 0
26 27 1 1
28 20 1 0
29 28 2 0
16 29 1 0
12 30 1 0
31 11 1 0
7 31 1 0
31 32 2 0
2 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 452.57Molecular Weight (Monoisotopic): 452.2588AlogP: 3.76#Rotatable Bonds: 4Polar Surface Area: 82.69Molecular Species: BASEHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.72CX LogP: 3.48CX LogD: 2.14Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.74Np Likeness Score: -0.50
References 1. Witten MR, Wu L, Lai CT, Kapilashrami K, Pusey M, Gallagher K, Chen Y, Yao W.. (2022) Inhibition of ALK2 with bicyclic pyridyllactams., 55 [PMID:34780900 ] [10.1016/j.bmcl.2021.128452 ]