The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7-(4-(hydroxymethyl)phenyl)-10,11-medzylenedioxy-20(S)-camptothecin ID: ALA5191443
PubChem CID: 168286912
Max Phase: Preclinical
Molecular Formula: C28H22N2O7
Molecular Weight: 498.49
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC[C@@]1(O)C(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1cc3c(cc1c2-c1ccc(CO)cc1)OCO3
Standard InChI: InChI=1S/C28H22N2O7/c1-2-28(34)19-8-21-25-17(10-30(21)26(32)18(19)12-35-27(28)33)24(15-5-3-14(11-31)4-6-15)16-7-22-23(37-13-36-22)9-20(16)29-25/h3-9,31,34H,2,10-13H2,1H3/t28-/m0/s1
Standard InChI Key: QGUYVTWYUBIPFZ-NDEPHWFRSA-N
Molfile:
RDKit 2D
37 43 0 0 0 0 0 0 0 0999 V2000
-2.5708 -0.3303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8562 0.0819 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1443 -0.3299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1443 -1.1551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8544 -1.5669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5708 -1.1588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3587 -1.4148 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8456 -0.7445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3586 -0.0743 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.4265 -1.5692 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.2849 -1.1526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2832 -0.3315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4316 0.0809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4316 0.9020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0634 -0.0761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5475 -0.7393 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.0663 -1.4045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4035 -2.1569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2202 -2.2359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6972 -1.5730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3615 -0.8236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7721 -0.1126 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5101 -1.6548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8456 -2.3996 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3683 -3.0626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5556 -2.9807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7611 -3.1936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1803 -2.6130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3422 -3.7734 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7789 -3.7736 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.1427 1.3127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1419 2.1313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4306 2.5419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2776 2.1347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2824 1.3143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4306 3.3630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1417 3.7736 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
1 9 1 0
4 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
3 13 1 0
13 14 1 0
12 15 1 0
15 16 1 0
16 17 1 0
11 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
16 21 1 0
21 22 2 0
20 23 1 0
24 23 1 0
25 24 1 0
26 25 1 0
19 26 1 0
26 27 1 0
27 28 1 0
26 29 1 1
25 30 2 0
31 14 2 0
32 31 1 0
33 32 2 0
34 33 1 0
35 34 2 0
14 35 1 0
33 36 1 0
36 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 498.49Molecular Weight (Monoisotopic): 498.1427AlogP: 2.97#Rotatable Bonds: 3Polar Surface Area: 120.11Molecular Species: NEUTRALHBA: 9HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.71CX Basic pKa: 3.63CX LogP: 1.72CX LogD: 1.72Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.36Np Likeness Score: 0.87
References 1. Zhang G, Yin R, Dai X, Wu G, Qi X, Yu R, Li J, Jiang T.. (2022) Design, synthesis, and biological evaluation of novel 7-substituted 10,11-methylenedioxy-camptothecin derivatives against drug-resistant small-cell lung cancer in vitro and in vivo., 241 [PMID:35932565 ] [10.1016/j.ejmech.2022.114610 ]