7-(4-(hydroxymethyl)phenyl)-10,11-medzylenedioxy-20(S)-camptothecin

ID: ALA5191443

PubChem CID: 168286912

Max Phase: Preclinical

Molecular Formula: C28H22N2O7

Molecular Weight: 498.49

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC[C@@]1(O)C(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1cc3c(cc1c2-c1ccc(CO)cc1)OCO3

Standard InChI:  InChI=1S/C28H22N2O7/c1-2-28(34)19-8-21-25-17(10-30(21)26(32)18(19)12-35-27(28)33)24(15-5-3-14(11-31)4-6-15)16-7-22-23(37-13-36-22)9-20(16)29-25/h3-9,31,34H,2,10-13H2,1H3/t28-/m0/s1

Standard InChI Key:  QGUYVTWYUBIPFZ-NDEPHWFRSA-N

Molfile:  

 
     RDKit          2D

 37 43  0  0  0  0  0  0  0  0999 V2000
   -2.5708   -0.3303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8562    0.0819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1443   -0.3299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1443   -1.1551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8544   -1.5669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5708   -1.1588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3587   -1.4148    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8456   -0.7445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3586   -0.0743    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4265   -1.5692    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.2849   -1.1526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2832   -0.3315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4316    0.0809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4316    0.9020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0634   -0.0761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5475   -0.7393    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0663   -1.4045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4035   -2.1569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2202   -2.2359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6972   -1.5730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3615   -0.8236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7721   -0.1126    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5101   -1.6548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8456   -2.3996    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3683   -3.0626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5556   -2.9807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7611   -3.1936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1803   -2.6130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3422   -3.7734    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7789   -3.7736    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1427    1.3127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1419    2.1313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4306    2.5419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2776    2.1347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2824    1.3143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4306    3.3630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1417    3.7736    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  1  9  1  0
  4 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
  3 13  1  0
 13 14  1  0
 12 15  1  0
 15 16  1  0
 16 17  1  0
 11 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 16 21  1  0
 21 22  2  0
 20 23  1  0
 24 23  1  0
 25 24  1  0
 26 25  1  0
 19 26  1  0
 26 27  1  0
 27 28  1  0
 26 29  1  1
 25 30  2  0
 31 14  2  0
 32 31  1  0
 33 32  2  0
 34 33  1  0
 35 34  2  0
 14 35  1  0
 33 36  1  0
 36 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5191443

    ---

Associated Targets(Human)

2008 (263 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SW-620 (52400 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 498.49Molecular Weight (Monoisotopic): 498.1427AlogP: 2.97#Rotatable Bonds: 3
Polar Surface Area: 120.11Molecular Species: NEUTRALHBA: 9HBD: 2
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 11.71CX Basic pKa: 3.63CX LogP: 1.72CX LogD: 1.72
Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.36Np Likeness Score: 0.87

References

1. Zhang G, Yin R, Dai X, Wu G, Qi X, Yu R, Li J, Jiang T..  (2022)  Design, synthesis, and biological evaluation of novel 7-substituted 10,11-methylenedioxy-camptothecin derivatives against drug-resistant small-cell lung cancer in vitro and in vivo.,  241  [PMID:35932565] [10.1016/j.ejmech.2022.114610]

Source