Dispyrin D

ID: ALA5191448

PubChem CID: 168286915

Max Phase: Preclinical

Molecular Formula: C18H22BrI2N3O2

Molecular Weight: 646.11

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN(C)CCCOc1c(I)cc(CCNC(=O)c2cc(Br)c[nH]2)cc1I

Standard InChI:  InChI=1S/C18H22BrI2N3O2/c1-24(2)6-3-7-26-17-14(20)8-12(9-15(17)21)4-5-22-18(25)16-10-13(19)11-23-16/h8-11,23H,3-7H2,1-2H3,(H,22,25)

Standard InChI Key:  OLNSMUVIVOISRL-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 26 27  0  0  0  0  0  0  0  0999 V2000
   -3.6330   -1.6862    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4403   -1.8559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8512   -1.1403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2977   -0.5285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5447   -0.8659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8515   -0.4181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8927    0.4059    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1172   -0.7946    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4240   -0.3468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6897   -0.7232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0034   -0.2754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0374    0.5488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6539    0.9945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3885    0.6180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4311   -0.2019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7409   -0.6535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1031    1.0306    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8178    0.6180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5325    1.0306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2471    0.6180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9618    1.0306    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.6764    0.6180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9618    1.8559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1457   -0.6145    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0
    0.6539    1.8197    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6764   -1.1403    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  1  1  0
  5  6  1  0
  6  7  2  0
  6  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 12 11  2  0
 13 12  1  0
 14 13  2  0
 15 14  1  0
 16 15  2  0
 11 16  1  0
 14 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 21 23  1  0
 15 24  1  0
 13 25  1  0
  3 26  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5191448

    ---

Associated Targets(Human)

OVCAR-3 (48710 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 646.11Molecular Weight (Monoisotopic): 644.8985AlogP: 4.29#Rotatable Bonds: 9
Polar Surface Area: 57.36Molecular Species: BASEHBA: 3HBD: 2
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 9.26CX LogP: 4.61CX LogD: 2.76
Aromatic Rings: 2Heavy Atoms: 26QED Weighted: 0.32Np Likeness Score: -0.68

References

1. Freire VF, Gubiani JR, Spencer TM, Hajdu E, Ferreira AG, Ferreira DAS, de Castro Levatti EV, Burdette JE, Camargo CH, Tempone AG, Berlinck RGS..  (2022)  Feature-Based Molecular Networking Discovery of Bromopyrrole Alkaloids from the Marine Sponge Agelas dispar.,  85  (5.0): [PMID:35427139] [10.1021/acs.jnatprod.2c00094]

Source