The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Sodium 4-(((S)-(1-(4-(3,4-dihydroisoquinolin-2(1H)-yl)-4-oxobutyl)-1H-tetrazol-5-yl)(phenyl)methyl)amino)-3-hydroxybutanoate ID: ALA5191559
PubChem CID: 168290063
Max Phase: Preclinical
Molecular Formula: C25H29N6NaO4
Molecular Weight: 478.55
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C([O-])CC(O)CN[C@@H](c1ccccc1)c1nnnn1CCCC(=O)N1CCc2ccccc2C1.[Na+]
Standard InChI: InChI=1S/C25H30N6O4.Na/c32-21(15-23(34)35)16-26-24(19-8-2-1-3-9-19)25-27-28-29-31(25)13-6-11-22(33)30-14-12-18-7-4-5-10-20(18)17-30;/h1-5,7-10,21,24,26,32H,6,11-17H2,(H,34,35);/q;+1/p-1/t21?,24-;/m0./s1
Standard InChI Key: ZUPOLCSLDPCFJZ-BNRSUNCTSA-M
Molfile:
RDKit 2D
36 38 0 0 0 0 0 0 0 0999 V2000
-4.1631 -1.3174 0.0000 Na 0 0 0 0 0 15 0 0 0 0 0 0
0.8200 1.9764 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.1526 2.4613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4074 3.2460 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2326 3.2460 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4876 2.4613 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.6444 2.2477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8580 1.4505 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.6551 1.2370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8687 0.4399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6658 0.2263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8794 -0.5706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6764 -0.7842 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.2959 -1.1541 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2851 -0.1435 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.8200 1.1511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5347 0.7385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5347 -0.0866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2494 -0.4992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2494 -1.3244 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.9640 -1.7370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9640 -2.5621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2493 -2.9748 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5347 -2.5621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5347 -1.7370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2496 -3.8035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9661 -4.2115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6764 -3.7994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6762 -2.9740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9640 -0.0866 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2279 2.8312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0252 2.6178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6064 3.2001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3927 3.9974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5999 4.2115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0134 3.6317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 2 1 0
3 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
12 14 2 0
10 15 1 0
2 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
21 20 1 0
22 21 1 0
23 22 2 0
24 23 1 0
25 24 1 0
20 25 1 0
23 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
22 29 1 0
19 30 2 0
7 31 1 1
32 31 2 0
33 32 1 0
34 33 2 0
35 34 1 0
36 35 2 0
31 36 1 0
M CHG 2 1 1 13 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 478.55Molecular Weight (Monoisotopic): 478.2329AlogP: 1.55#Rotatable Bonds: 11Polar Surface Area: 133.47Molecular Species: ACIDHBA: 8HBD: 3#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.54CX Basic pKa: 6.82CX LogP: -1.01CX LogD: -1.56Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.38Np Likeness Score: -1.32
References 1. Ulgheri F, Spanu P, Deligia F, Loriga G, Fuggetta MP, de Haan I, Chandgudge A, Groves M, Domling A.. (2022) Design, synthesis and biological evaluation of 1,5-disubstituted α-amino tetrazole derivatives as non-covalent inflammasome-caspase-1 complex inhibitors with potential application against immune and inflammatory disorders., 229 [PMID:34823899 ] [10.1016/j.ejmech.2021.114002 ]