2-(4,4-difluoro-3-(6-oxo-1,6-dihydropyridin-3-yl)cyclohexyl)-N-(5-(4-fluorophenoxy)pyridin-2-yl)propanamide

ID: ALA5191640

PubChem CID: 163237683

Max Phase: Preclinical

Molecular Formula: C25H24F3N3O3

Molecular Weight: 471.48

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C(=O)Nc1ccc(Oc2ccc(F)cc2)cn1)C1CCC(F)(F)C(c2ccc(=O)[nH]c2)C1

Standard InChI:  InChI=1S/C25H24F3N3O3/c1-15(16-10-11-25(27,28)21(12-16)17-2-9-23(32)30-13-17)24(33)31-22-8-7-20(14-29-22)34-19-5-3-18(26)4-6-19/h2-9,13-16,21H,10-12H2,1H3,(H,30,32)(H,29,31,33)

Standard InChI Key:  PXTGCCQQYUKLIU-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
    2.7719   -1.0087    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.0597   -1.4251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7765   -1.8337    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0382    4.2861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8611    4.2914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2753    3.5826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8678    2.8680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0418    2.8667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6313    3.5761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2826    2.1553    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8728    1.4397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2926    0.7292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8835    0.0141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0580    0.0108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6433    0.7285    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0548    1.4406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6472   -0.7042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8225   -0.7060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4118   -1.4210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4127   -1.4228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8256   -2.1343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4087    0.0072    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.8235   -2.1378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8266   -0.7095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6512   -0.7113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6482   -2.1396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0589   -2.8546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6433   -3.5670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0534   -4.2815    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.8789   -4.2838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2926   -3.5655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8801   -2.8539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2906   -4.9983    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6225    4.9983    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  7 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
 14 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 19 21  1  0
 18 22  2  0
 20 23  1  0
 20 24  1  0
 24 25  1  0
 25  2  1  0
 23 26  1  0
 26  2  1  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
 30 33  2  0
  4 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5191640

    ---

Associated Targets(Human)

MRGPRX2 Tchem Mas-related G-protein coupled receptor member X2 (67 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 471.48Molecular Weight (Monoisotopic): 471.1770AlogP: 5.50#Rotatable Bonds: 6
Polar Surface Area: 84.08Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.09CX Basic pKa: 3.34CX LogP: 3.95CX LogD: 3.95
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.50Np Likeness Score: -0.60

References

1. Sabnis RW..  (2022)  Novel MRGX2 Antagonists for Treating Diseases.,  13  (7.0): [PMID:35928854] [10.1021/acsmedchemlett.2c00262]

Source