The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(4,4-difluoro-3-(6-oxo-1,6-dihydropyridin-3-yl)cyclohexyl)-N-(5-(4-fluorophenoxy)pyridin-2-yl)propanamide ID: ALA5191640
PubChem CID: 163237683
Max Phase: Preclinical
Molecular Formula: C25H24F3N3O3
Molecular Weight: 471.48
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C(=O)Nc1ccc(Oc2ccc(F)cc2)cn1)C1CCC(F)(F)C(c2ccc(=O)[nH]c2)C1
Standard InChI: InChI=1S/C25H24F3N3O3/c1-15(16-10-11-25(27,28)21(12-16)17-2-9-23(32)30-13-17)24(33)31-22-8-7-20(14-29-22)34-19-5-3-18(26)4-6-19/h2-9,13-16,21H,10-12H2,1H3,(H,30,32)(H,29,31,33)
Standard InChI Key: PXTGCCQQYUKLIU-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
2.7719 -1.0087 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.0597 -1.4251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7765 -1.8337 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.0382 4.2861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8611 4.2914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2753 3.5826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8678 2.8680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0418 2.8667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6313 3.5761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2826 2.1553 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.8728 1.4397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2926 0.7292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8835 0.0141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0580 0.0108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6433 0.7285 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.0548 1.4406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6472 -0.7042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.8225 -0.7060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4118 -1.4210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4127 -1.4228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8256 -2.1343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4087 0.0072 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.8235 -2.1378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8266 -0.7095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6512 -0.7113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6482 -2.1396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0589 -2.8546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6433 -3.5670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0534 -4.2815 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8789 -4.2838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2926 -3.5655 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8801 -2.8539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2906 -4.9983 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.6225 4.9983 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
7 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
14 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
19 21 1 0
18 22 2 0
20 23 1 0
20 24 1 0
24 25 1 0
25 2 1 0
23 26 1 0
26 2 1 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 2 0
32 27 1 0
30 33 2 0
4 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 471.48Molecular Weight (Monoisotopic): 471.1770AlogP: 5.50#Rotatable Bonds: 6Polar Surface Area: 84.08Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.09CX Basic pKa: 3.34CX LogP: 3.95CX LogD: 3.95Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.50Np Likeness Score: -0.60