The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3,5-bis(trifluoromethyl)phenyl)-4-hydroxy-1-(4-methoxybenzyl)-1H-1,2,3-triazole-5-carboxamide ID: ALA5191752
PubChem CID: 168289125
Max Phase: Preclinical
Molecular Formula: C19H14F6N4O3
Molecular Weight: 460.33
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(Cn2nnc(O)c2C(=O)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1
Standard InChI: InChI=1S/C19H14F6N4O3/c1-32-14-4-2-10(3-5-14)9-29-15(17(31)27-28-29)16(30)26-13-7-11(18(20,21)22)6-12(8-13)19(23,24)25/h2-8,31H,9H2,1H3,(H,26,30)
Standard InChI Key: VNLLULBRBYCTHR-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
-3.4836 -0.8168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7690 -0.4045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0571 -0.8163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0571 -1.6416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7672 -2.0533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4836 -1.6453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1983 -2.0578 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.1983 -2.8830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3425 -0.4038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3425 0.4214 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.0571 0.8339 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.8716 1.6553 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0702 1.7363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7380 0.9764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6576 2.4509 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0589 0.7628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2725 -0.0341 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.6424 1.3463 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4395 1.1327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0232 1.7161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8176 1.5024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0313 0.7051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4518 0.1234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6540 0.3322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4012 2.0859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1876 2.8830 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.1983 1.8724 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.9847 2.6695 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.6654 -0.6736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4624 -0.8872 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.0819 -1.2571 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.8788 -1.4705 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
6 7 1 0
7 8 1 0
3 9 1 0
9 10 1 0
11 10 1 0
11 12 2 0
12 13 1 0
14 13 2 0
10 14 1 0
13 15 1 0
14 16 1 0
16 17 2 0
16 18 1 0
18 19 1 0
20 19 2 0
21 20 1 0
22 21 2 0
23 22 1 0
24 23 2 0
19 24 1 0
21 25 1 0
25 26 1 0
25 27 1 0
25 28 1 0
23 29 1 0
29 30 1 0
29 31 1 0
29 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 460.33Molecular Weight (Monoisotopic): 460.0970AlogP: 4.33#Rotatable Bonds: 5Polar Surface Area: 89.27Molecular Species: ACIDHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 2.35CX Basic pKa: ┄CX LogP: 4.65CX LogD: 3.14Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.55Np Likeness Score: -1.52
References 1. Pippione AC, Kilic-Kurt Z, Kovachka S, Sainas S, Rolando B, Denasio E, Pors K, Adinolfi S, Zonari D, Bagnati R, Lolli ML, Spyrakis F, Oliaro-Bosso S, Boschi D.. (2022) New aldo-keto reductase 1C3 (AKR1C3) inhibitors based on the hydroxytriazole scaffold., 237 [PMID:35447434 ] [10.1016/j.ejmech.2022.114366 ]