3-(8-(4-(3-(furan-2-yl)acryloyl)phenoxy)nonyl)-1-methyl-1H-imidazol-3-ium bromide

ID: ALA5191821

PubChem CID: 132276169

Max Phase: Preclinical

Molecular Formula: C26H33BrN2O3

Molecular Weight: 421.56

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(CCCCCCC[n+]1ccn(C)c1)Oc1ccc(C(=O)/C=C/c2ccco2)cc1.[Br-]

Standard InChI:  InChI=1S/C26H33N2O3.BrH/c1-22(9-6-4-3-5-7-17-28-19-18-27(2)21-28)31-25-13-11-23(12-14-25)26(29)16-15-24-10-8-20-30-24;/h8,10-16,18-22H,3-7,9,17H2,1-2H3;1H/q+1;/p-1/b16-15+;

Standard InChI Key:  GOUORGXJBPALJQ-GEEYTBSJSA-M

Molfile:  

     RDKit          2D

 32 33  0  0  0  0  0  0  0  0999 V2000
    5.4071   -1.8936    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   -3.2697   -0.0001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5551    0.4121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8432    0.0001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8432   -0.8249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5533   -1.2367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2697   -0.8286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9843    0.4124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6990   -0.0001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9843    1.2374    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4136    0.4124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1282   -0.0001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2144   -0.8204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0213   -0.9919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4336   -0.2776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8817    0.3352    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1285   -1.2374    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4140   -0.8249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3006   -1.2374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4140    0.0001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0153   -0.8249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7298   -1.2374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4445   -0.8249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1591   -1.2374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8736   -0.8249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5884   -1.2374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3031   -0.8249    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.3893   -0.0047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1960    0.1666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6085   -0.5474    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0565   -1.1604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4336   -0.5474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  3  2  2  0
  4  3  1  0
  5  4  2  0
  6  5  1  0
  2  7  1  0
  7  6  2  0
  2  8  1  0
  8  9  1  0
  8 10  2  0
  9 11  2  0
 11 12  1  0
 13 12  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 12  1  0
  5 17  1  0
 17 18  1  0
 18 19  1  0
 18 20  1  0
 19 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 28 27  1  0
 28 29  2  0
 29 30  1  0
 30 31  1  0
 31 27  2  0
 30 32  1  0
M  CHG  2   1  -1  27   1
M  END

Associated Targets(non-human)

Leishmania panamensis (230 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Trypanosoma cruzi (99888 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 421.56Molecular Weight (Monoisotopic): 421.2486AlogP: 5.61#Rotatable Bonds: 13
Polar Surface Area: 48.25Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 1.92CX LogD: 1.92
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.16Np Likeness Score: -0.27

References

1. Gupta O, Pradhan T, Bhatia R, Monga V..  (2021)  Recent advancements in anti-leishmanial research: Synthetic strategies and structural activity relationships.,  223  [PMID:34171661] [10.1016/j.ejmech.2021.113606]

Source