The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(8-(4-(3-(furan-2-yl)acryloyl)phenoxy)nonyl)-1-methyl-1H-imidazol-3-ium bromide ID: ALA5191821
PubChem CID: 132276169
Max Phase: Preclinical
Molecular Formula: C26H33BrN2O3
Molecular Weight: 421.56
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(CCCCCCC[n+]1ccn(C)c1)Oc1ccc(C(=O)/C=C/c2ccco2)cc1.[Br-]
Standard InChI: InChI=1S/C26H33N2O3.BrH/c1-22(9-6-4-3-5-7-17-28-19-18-27(2)21-28)31-25-13-11-23(12-14-25)26(29)16-15-24-10-8-20-30-24;/h8,10-16,18-22H,3-7,9,17H2,1-2H3;1H/q+1;/p-1/b16-15+;
Standard InChI Key: GOUORGXJBPALJQ-GEEYTBSJSA-M
Molfile:
RDKit 2D
32 33 0 0 0 0 0 0 0 0999 V2000
5.4071 -1.8936 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
-3.2697 -0.0001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5551 0.4121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8432 0.0001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8432 -0.8249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5533 -1.2367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2697 -0.8286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9843 0.4124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6990 -0.0001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9843 1.2374 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.4136 0.4124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.1282 -0.0001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2144 -0.8204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.0213 -0.9919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.4336 -0.2776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.8817 0.3352 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.1285 -1.2374 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.4140 -0.8249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3006 -1.2374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4140 0.0001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0153 -0.8249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7298 -1.2374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4445 -0.8249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1591 -1.2374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8736 -0.8249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5884 -1.2374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3031 -0.8249 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3893 -0.0047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1960 0.1666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6085 -0.5474 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0565 -1.1604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4336 -0.5474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3 2 2 0
4 3 1 0
5 4 2 0
6 5 1 0
2 7 1 0
7 6 2 0
2 8 1 0
8 9 1 0
8 10 2 0
9 11 2 0
11 12 1 0
13 12 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 12 1 0
5 17 1 0
17 18 1 0
18 19 1 0
18 20 1 0
19 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
28 27 1 0
28 29 2 0
29 30 1 0
30 31 1 0
31 27 2 0
30 32 1 0
M CHG 2 1 -1 27 1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 421.56Molecular Weight (Monoisotopic): 421.2486AlogP: 5.61#Rotatable Bonds: 13Polar Surface Area: 48.25Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 1.92CX LogD: 1.92Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.16Np Likeness Score: -0.27
References 1. Gupta O, Pradhan T, Bhatia R, Monga V.. (2021) Recent advancements in anti-leishmanial research: Synthetic strategies and structural activity relationships., 223 [PMID:34171661 ] [10.1016/j.ejmech.2021.113606 ]