6-((S)-3-Hydroxypyrrolidin-1-yl)-3-(2-methylbenzyl)isobenzofuran-1(3H)-one

ID: ALA5192065

PubChem CID: 168289862

Max Phase: Preclinical

Molecular Formula: C20H21NO3

Molecular Weight: 323.39

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ccccc1CC1OC(=O)c2cc(N3CC[C@H](O)C3)ccc21

Standard InChI:  InChI=1S/C20H21NO3/c1-13-4-2-3-5-14(13)10-19-17-7-6-15(11-18(17)20(23)24-19)21-9-8-16(22)12-21/h2-7,11,16,19,22H,8-10,12H2,1H3/t16-,19?/m0/s1

Standard InChI Key:  PANBMLFTKYYCTD-UCFFOFKASA-N

Molfile:  

 
     RDKit          2D

 24 27  0  0  0  0  0  0  0  0999 V2000
   -1.0243   -0.1896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0243   -1.0146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7388   -1.4271    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4924   -1.0916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0445   -1.7047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8650   -1.6184    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6320   -2.4191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8250   -2.2476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3098   -1.4271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4046   -1.0146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1892   -1.2696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4441   -2.0542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.6741   -0.6021    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1892    0.0652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4441    0.8499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2510    1.0214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8031    0.4083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6101    0.5798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8650    1.3644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3130    1.9775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5060    1.8060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9540    2.4191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4046   -0.1896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3098    0.2228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  1  0
  4  3  1  0
  5  4  1  0
  5  6  1  6
  7  5  1  0
  8  7  1  0
  3  8  1  0
  2  9  2  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 13 11  1  0
 14 13  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 21 16  2  0
 20 21  1  0
 21 22  1  0
 23 14  1  0
 10 23  2  0
 23 24  1  0
 24  1  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5192065

    ---

Associated Targets(non-human)

Maob Monoamine oxidase B (2209 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 323.39Molecular Weight (Monoisotopic): 323.1521AlogP: 3.02#Rotatable Bonds: 3
Polar Surface Area: 49.77Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.99CX Basic pKa: 1.12CX LogP: 3.48CX LogD: 3.48
Aromatic Rings: 2Heavy Atoms: 24QED Weighted: 0.88Np Likeness Score: -0.09

References

1. Liu K, Zhou S, Zhou J, Bo R, Wang X, Xu T, Yuan Y, Xu B..  (2022)  Discovery of 3, 6-disubstituted isobenzofuran-1(3H)-ones as novel inhibitors of monoamine oxidases.,  67  [PMID:35472505] [10.1016/j.bmcl.2022.128748]

Source