Methyl ((2-isobutyl-4-(4-(oxazol-2-ylmethyl)phenyl)thiazol-5-yl)sulfonyl)carbamate

ID: ALA5192182

PubChem CID: 168288298

Max Phase: Preclinical

Molecular Formula: C19H21N3O5S2

Molecular Weight: 435.53

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COC(=O)NS(=O)(=O)c1sc(CC(C)C)nc1-c1ccc(Cc2ncco2)cc1

Standard InChI:  InChI=1S/C19H21N3O5S2/c1-12(2)10-16-21-17(18(28-16)29(24,25)22-19(23)26-3)14-6-4-13(5-7-14)11-15-20-8-9-27-15/h4-9,12H,10-11H2,1-3H3,(H,22,23)

Standard InChI Key:  OYBQJPILNVHMDI-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 31  0  0  0  0  0  0  0  0999 V2000
   -0.8260    3.8629    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0200    4.0390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3965    3.3269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1519    2.7106    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9075    3.0419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6197    2.6253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6149    1.8002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8980    1.3918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8933    0.5667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6054    0.1501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3222    0.5586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3270    1.3836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6007   -0.6748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9304   -1.1559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1333   -0.9423    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3468   -0.1451    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4513   -0.3577    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4502   -1.5259    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2474   -1.3123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4610   -0.5151    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8310   -1.8958    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6282   -1.6822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1809   -1.9420    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0057   -1.9468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2653   -1.1636    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4870   -2.6170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1471   -3.3688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3260   -3.4503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6282   -4.0390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  1  5  2  0
  4  5  1  0
  6  5  1  0
  7  6  1  0
  8  7  1  0
  9  8  2  0
 10  9  1  0
 11 10  2  0
  7 12  2  0
 12 11  1  0
 13 10  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 15 17  2  0
 15 18  1  0
 18 19  1  0
 19 20  2  0
 19 21  1  0
 21 22  1  0
 14 23  1  0
 23 24  1  0
 25 13  1  0
 24 25  2  0
 24 26  1  0
 26 27  1  0
 27 28  1  0
 27 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5192182

    ---

Associated Targets(Human)

AGTR2 Tchem Angiotensin II type 2 (AT-2) receptor (2549 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
AGTR1 Tclin Type-1 angiotensin II receptor (5176 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 435.53Molecular Weight (Monoisotopic): 435.0923AlogP: 3.63#Rotatable Bonds: 7
Polar Surface Area: 111.39Molecular Species: ACIDHBA: 8HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 4.57CX Basic pKa: 1.04CX LogP: 3.50CX LogD: 2.56
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.60Np Likeness Score: -0.88

References

1. Gopalan G, Palo-Nieto C, Petersen NN, Hallberg M, Larhed M..  (2022)  Angiotensin II AT2 receptor ligands with phenylthiazole scaffolds.,  65  [PMID:35550979] [10.1016/j.bmc.2022.116790]

Source