(R)-4-(2-(1H-indol-4-yl)-6-(1-isopropyl-1H-pyrazol-5-yl)quinazolin-4-yl)-3-methylmorpholine

ID: ALA5192206

PubChem CID: 168288703

Max Phase: Preclinical

Molecular Formula: C27H28N6O

Molecular Weight: 452.56

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)n1nccc1-c1ccc2nc(-c3cccc4[nH]ccc34)nc(N3CCOC[C@H]3C)c2c1

Standard InChI:  InChI=1S/C27H28N6O/c1-17(2)33-25(10-12-29-33)19-7-8-24-22(15-19)27(32-13-14-34-16-18(32)3)31-26(30-24)21-5-4-6-23-20(21)9-11-28-23/h4-12,15,17-18,28H,13-14,16H2,1-3H3/t18-/m1/s1

Standard InChI Key:  XUPVSBSMTHWJIY-GOSISDBHSA-N

Molfile:  

 
     RDKit          2D

 34 39  0  0  0  0  0  0  0  0999 V2000
    2.6709    1.0270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3850    1.4402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3850    2.2640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6730    2.6711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9629    2.2585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9629    1.4389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2535    1.0291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5390    1.4423    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1688    1.0273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1688    0.2035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5411   -0.2051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2535    0.2054    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.5411   -1.0243    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1695   -1.4318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1695   -2.2552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5409   -2.6711    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2516   -2.2553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2516   -1.4319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8783   -1.0211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8808   -0.2041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5917    0.2035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5917    1.0273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8808    1.4433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3006   -0.2070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3825   -1.0221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1847   -1.1943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5980   -0.4854    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0487    0.1274    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2193    0.9286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6108    1.4770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9985    1.1814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9985    0.8886    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6637    0.1346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8431    0.2203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  6  7  1  0
  8  7  2  0
  9  8  1  0
 10  9  2  0
 10 11  1  0
  7 12  1  0
 12 11  2  0
 11 13  1  0
 14 13  1  0
 15 14  1  0
 16 15  1  0
 16 17  1  0
 13 18  1  0
 18 17  1  0
 14 19  1  1
 10 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
  9 23  1  0
 24 21  1  0
 25 24  2  0
 26 25  1  0
 27 26  2  0
 28 27  1  0
 28 24  1  0
 29 28  1  0
 29 30  1  0
 29 31  1  0
  2 32  1  0
 32 33  1  0
 33 34  2  0
  1 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5192206

    ---

Associated Targets(Human)

ATR Tchem Serine-protein kinase ATR (986 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 452.56Molecular Weight (Monoisotopic): 452.2325AlogP: 5.45#Rotatable Bonds: 4
Polar Surface Area: 71.86Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 4.54CX LogP: 5.49CX LogD: 5.49
Aromatic Rings: 5Heavy Atoms: 34QED Weighted: 0.39Np Likeness Score: -1.23

References

1. Bin H, Chen P, Wu M, Wang F, Lin G, Pan S, Liu J, Mu B, Nan J, Huang Q, Li L, Yang S..  (2022)  Discovery of a potent and highly selective inhibitor of ataxia telangiectasia mutated and Rad3-Related (ATR) kinase: Structural activity relationship and antitumor activity both in vitro and in vivo.,  232  [PMID:35183872] [10.1016/j.ejmech.2022.114187]

Source