The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-Fluorophenyl)-3-(4-(4-(2-hydroxypropan-2-yl)-6-(trifluoromethyl)pyridin-3-yl)phenyl)oxetane-3-carboxamide ID: ALA5192384
PubChem CID: 138609155
Max Phase: Preclinical
Molecular Formula: C25H22F4N2O3
Molecular Weight: 474.45
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(O)c1cc(C(F)(F)F)ncc1-c1ccc(C2(C(=O)Nc3ccc(F)cc3)COC2)cc1
Standard InChI: InChI=1S/C25H22F4N2O3/c1-23(2,33)20-11-21(25(27,28)29)30-12-19(20)15-3-5-16(6-4-15)24(13-34-14-24)22(32)31-18-9-7-17(26)8-10-18/h3-12,33H,13-14H2,1-2H3,(H,31,32)
Standard InChI Key: ICJRFPZBMMQAPU-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
-0.2062 -0.5642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6187 -0.5649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0326 -1.2818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6223 -1.9958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2047 -2.0005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8602 -1.2818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2740 -0.5651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1015 -0.5651 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.5153 0.1515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1017 0.8683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5149 1.5824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3427 1.5824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7558 0.8701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3464 0.1515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7565 2.2991 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.8602 0.1515 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6732 -1.4996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4589 -2.2991 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.6460 -2.0813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4478 -1.2807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8613 -0.5641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8609 -1.9947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6884 -1.9947 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.1014 -1.2826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6921 -0.5641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9290 -1.2826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6202 -1.2807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4475 0.1524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3428 -1.9993 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-4.3428 -0.5659 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-4.7565 -1.2826 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.8613 0.8691 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.6200 0.1524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0337 0.8691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
3 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
9 14 1 0
12 15 1 0
7 16 2 0
6 17 1 0
17 18 1 0
18 19 1 0
6 19 1 0
20 21 2 0
20 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
21 25 1 0
24 26 1 0
20 27 1 0
1 27 2 0
27 5 1 0
21 28 1 0
26 29 1 0
26 30 1 0
26 31 1 0
28 32 1 0
28 33 1 0
28 34 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 474.45Molecular Weight (Monoisotopic): 474.1567AlogP: 5.04#Rotatable Bonds: 5Polar Surface Area: 71.45Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.63CX Basic pKa: 0.95CX LogP: 4.51CX LogD: 4.51Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.51Np Likeness Score: -0.88
References 1. Li D, Sloman DL, Achab A, Zhou H, McGowan MA, White C, Gibeau C, Zhang H, Pu Q, Bharathan I, Hopkins B, Liu K, Ferguson H, Fradera X, Lesburg CA, Martinot TA, Qi J, Song ZJ, Yin J, Zhang H, Song L, Wan B, DAddio S, Solban N, Miller JR, Zamlynny B, Bass A, Freeland E, Ykoruk B, Hilliard C, Ferraro J, Zhai J, Knemeyer I, Otte KM, Vincent S, Sciammetta N, Pasternak A, Bennett DJ, Han Y.. (2022) Oxetane Promise Delivered: Discovery of Long-Acting IDO1 Inhibitors Suitable for Q3W Oral or Parenteral Dosing., 65 (8.0): [PMID:35239336 ] [10.1021/acs.jmedchem.1c01670 ]