(trans)-(S)-4-(3-(2-(isopropylamino)-2-oxoethyl)phenoxy)-N-methyl-N-(3-methyl-4-((3-methylpiperazin-1-yl)methyl)phenyl)cyclohexanecarboxamide

ID: ALA5192530

PubChem CID: 56959013

Max Phase: Preclinical

Molecular Formula: C32H46N4O3

Molecular Weight: 534.75

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cc(N(C)C(=O)[C@H]2CC[C@H](Oc3cccc(CC(=O)NC(C)C)c3)CC2)ccc1CN1CCN[C@@H](C)C1

Standard InChI:  InChI=1S/C32H46N4O3/c1-22(2)34-31(37)19-25-7-6-8-30(18-25)39-29-13-10-26(11-14-29)32(38)35(5)28-12-9-27(23(3)17-28)21-36-16-15-33-24(4)20-36/h6-9,12,17-18,22,24,26,29,33H,10-11,13-16,19-21H2,1-5H3,(H,34,37)/t24-,26-,29-/m0/s1

Standard InChI Key:  UNZQIZYYDGBZSR-MIUCGUHXSA-N

Molfile:  

 
     RDKit          2D

 39 42  0  0  0  0  0  0  0  0999 V2000
   -4.9980    1.4440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2836    1.8567    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5693    1.4440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5693    0.6192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2836    0.2069    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9980    0.6192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2836   -0.6177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5695   -1.0299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8552   -0.6178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1435   -1.0295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1435   -1.8544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8534   -2.2660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5695   -1.8581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2836   -2.2704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4294   -2.2667    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7152   -1.8544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7152   -1.0298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4294   -0.6175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4293    0.2069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7152    0.6192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0010    0.2070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0010   -0.6174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7152    1.4439    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0010    1.8563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0008    2.6809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7113    3.0913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4256    2.6788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4272    1.8584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7158    1.4420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0010   -2.2667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4294   -3.0913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8551    1.8566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1414    1.4460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8555    1.8584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5697    1.4460    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.8555    2.6828    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2839    1.8584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9980    1.4460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2839    2.6828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  1  0
  4  3  1  0
  5  4  1  0
  6  5  1  0
  1  6  1  0
  5  7  1  0
  7  8  1  0
  9  8  2  0
 10  9  1  0
 11 10  2  0
 12 11  1  0
 13 12  2  0
  8 13  1  0
 13 14  1  0
 11 15  1  0
 15 16  1  0
 17 16  1  1
 18 17  1  0
 19 18  1  0
 20 19  1  0
 21 20  1  0
 22 21  1  0
 17 22  1  0
 20 23  1  6
 23 24  1  0
 25 24  2  0
 26 25  1  0
 27 26  2  0
 28 27  1  0
 29 28  2  0
 24 29  1  0
 16 30  2  0
 15 31  1  0
  3 32  1  1
 28 33  1  0
 33 34  1  0
 34 35  1  0
 34 36  2  0
 35 37  1  0
 37 38  1  0
 37 39  1  0
M  END

Associated Targets(Human)

MLNR Tchem Motilin receptor (1724 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CYP3A4 Tclin Cytochrome P450 3A4 (53859 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 534.75Molecular Weight (Monoisotopic): 534.3570AlogP: 4.46#Rotatable Bonds: 9
Polar Surface Area: 73.91Molecular Species: BASEHBA: 5HBD: 2
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 9.35CX LogP: 4.30CX LogD: 2.37
Aromatic Rings: 2Heavy Atoms: 39QED Weighted: 0.50Np Likeness Score: -1.20

References

1. Toda N, Shida T, Takano R, Katagiri T, Hirouchi M, Abe M, Soma K, Nakagami Y, Yamazaki M..  (2022)  Discovery of DS-3801b, a non-macrolide GPR38 agonist with N-methylanilide structure.,  59  [PMID:35051575] [10.1016/j.bmcl.2022.128554]

Source