1-acetyl-N-(2,4-difluoro-5-(furan-2-yl)phenyl)indoline-5-sulfonamide

ID: ALA5192612

PubChem CID: 168288326

Max Phase: Preclinical

Molecular Formula: C20H16F2N2O4S

Molecular Weight: 418.42

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)N1CCc2cc(S(=O)(=O)Nc3cc(-c4ccco4)c(F)cc3F)ccc21

Standard InChI:  InChI=1S/C20H16F2N2O4S/c1-12(25)24-7-6-13-9-14(4-5-19(13)24)29(26,27)23-18-10-15(16(21)11-17(18)22)20-3-2-8-28-20/h2-5,8-11,23H,6-7H2,1H3

Standard InChI Key:  IUJVQLHZPKYGGA-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
   -1.9632   -0.6435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2486   -0.2312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5368   -0.6431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5368   -1.4683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2468   -1.8801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9632   -1.4720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7512   -1.7280    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2381   -1.0577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7511   -0.3875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9655   -2.5280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3799   -3.1137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7656   -2.7424    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.1804   -0.2289    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    0.8977   -0.6431    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.6151   -0.2289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6153    0.5993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3308    1.0115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0483    0.5972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0499   -0.2268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3354   -0.6449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3308    1.8397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6610    2.3263    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9169    3.1137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7447    3.1137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0005    2.3263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5953    0.4895    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2328    0.4895    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7656    1.0113    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.3354   -1.4732    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  1  9  1  0
  7 10  1  0
 10 11  1  0
 10 12  2  0
  3 13  1  0
 13 14  1  0
 14 15  1  0
 16 15  2  0
 17 16  1  0
 18 17  2  0
 19 18  1  0
 20 19  2  0
 15 20  1  0
 21 17  1  0
 21 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 21  2  0
 13 26  2  0
 13 27  2  0
 18 28  1  0
 20 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5192612

    ---

Associated Targets(Human)

TRIM24 Tchem Transcription intermediary factor 1-alpha (2087 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 418.42Molecular Weight (Monoisotopic): 418.0799AlogP: 3.93#Rotatable Bonds: 4
Polar Surface Area: 79.62Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 8.52CX Basic pKa: CX LogP: 2.60CX LogD: 2.57
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.70Np Likeness Score: -2.02

References

1. Xiang Q, Luo G, Zhang C, Hu Q, Wang C, Wu T, Xu H, Hu J, Zhuang X, Zhang M, Wu S, Xu J, Zhang Y, Liu J, Xu Y..  (2022)  Discovery, optimization and evaluation of 1-(indolin-1-yl)ethan-1-ones as novel selective TRIM24/BRPF1 bromodomain inhibitors.,  236  [PMID:35385803] [10.1016/j.ejmech.2022.114311]

Source