The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Methyl ((4-(4-((2-(tert-butyl)-1H-imidazol-1-yl)methyl)phenyl)-2-propylthiazol-5-yl)sulfonyl)carbamate ID: ALA5192639
PubChem CID: 166492455
Max Phase: Preclinical
Molecular Formula: C22H28N4O4S2
Molecular Weight: 476.62
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCc1nc(-c2ccc(Cn3ccnc3C(C)(C)C)cc2)c(S(=O)(=O)NC(=O)OC)s1
Standard InChI: InChI=1S/C22H28N4O4S2/c1-6-7-17-24-18(19(31-17)32(28,29)25-21(27)30-5)16-10-8-15(9-11-16)14-26-13-12-23-20(26)22(2,3)4/h8-13H,6-7,14H2,1-5H3,(H,25,27)
Standard InChI Key: SHCZNRIAHSPXEX-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
-1.4482 3.9502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8351 3.3981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6635 4.2051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6197 3.1432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2220 2.8461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5849 3.0177 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.9974 2.3031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4454 1.6900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3081 2.0256 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0227 1.6131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0227 0.7881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3081 0.3756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3081 -0.4493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0227 -0.8619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7372 -0.4493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7372 0.3756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0227 -1.6869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3553 -2.1718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4293 -1.9169 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.0138 -1.3321 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.2168 -1.1187 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0426 -2.4690 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8274 -2.2140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0410 -1.4169 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4407 -2.7663 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2256 -2.5112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6101 -2.9565 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-1.4352 -2.9565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6902 -2.1718 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.9202 -3.6239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7407 -3.5377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2256 -4.2051 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
2 3 1 0
2 4 1 0
5 2 1 0
5 6 2 0
6 7 1 0
8 7 2 0
5 9 1 0
8 9 1 0
10 9 1 0
11 10 1 0
12 11 1 0
13 12 2 0
14 13 1 0
15 14 2 0
11 16 2 0
16 15 1 0
17 14 1 0
17 18 2 0
18 19 1 0
19 20 2 0
19 21 2 0
19 22 1 0
22 23 1 0
23 24 2 0
23 25 1 0
25 26 1 0
18 27 1 0
27 28 1 0
29 17 1 0
28 29 2 0
28 30 1 0
30 31 1 0
31 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 476.62Molecular Weight (Monoisotopic): 476.1552AlogP: 4.35#Rotatable Bonds: 7Polar Surface Area: 103.18Molecular Species: ACIDHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 4.57CX Basic pKa: 6.67CX LogP: 3.62CX LogD: 4.06Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.54Np Likeness Score: -1.19
References 1. Gopalan G, Palo-Nieto C, Petersen NN, Hallberg M, Larhed M.. (2022) Angiotensin II AT2 receptor ligands with phenylthiazole scaffolds., 65 [PMID:35550979 ] [10.1016/j.bmc.2022.116790 ]