Methyl ((4-(4-((2-(tert-butyl)-1H-imidazol-1-yl)methyl)phenyl)-2-propylthiazol-5-yl)sulfonyl)carbamate

ID: ALA5192639

PubChem CID: 166492455

Max Phase: Preclinical

Molecular Formula: C22H28N4O4S2

Molecular Weight: 476.62

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCc1nc(-c2ccc(Cn3ccnc3C(C)(C)C)cc2)c(S(=O)(=O)NC(=O)OC)s1

Standard InChI:  InChI=1S/C22H28N4O4S2/c1-6-7-17-24-18(19(31-17)32(28,29)25-21(27)30-5)16-10-8-15(9-11-16)14-26-13-12-23-20(26)22(2,3)4/h8-13H,6-7,14H2,1-5H3,(H,25,27)

Standard InChI Key:  SHCZNRIAHSPXEX-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 34  0  0  0  0  0  0  0  0999 V2000
   -1.4482    3.9502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8351    3.3981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6635    4.2051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6197    3.1432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2220    2.8461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5849    3.0177    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.9974    2.3031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4454    1.6900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3081    2.0256    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0227    1.6131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0227    0.7881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3081    0.3756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3081   -0.4493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0227   -0.8619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7372   -0.4493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7372    0.3756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0227   -1.6869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3553   -2.1718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4293   -1.9169    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.0138   -1.3321    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.2168   -1.1187    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0426   -2.4690    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8274   -2.2140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0410   -1.4169    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4407   -2.7663    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2256   -2.5112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6101   -2.9565    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4352   -2.9565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6902   -2.1718    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9202   -3.6239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7407   -3.5377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2256   -4.2051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  1  0
  2  4  1  0
  5  2  1  0
  5  6  2  0
  6  7  1  0
  8  7  2  0
  5  9  1  0
  8  9  1  0
 10  9  1  0
 11 10  1  0
 12 11  1  0
 13 12  2  0
 14 13  1  0
 15 14  2  0
 11 16  2  0
 16 15  1  0
 17 14  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 19 21  2  0
 19 22  1  0
 22 23  1  0
 23 24  2  0
 23 25  1  0
 25 26  1  0
 18 27  1  0
 27 28  1  0
 29 17  1  0
 28 29  2  0
 28 30  1  0
 30 31  1  0
 31 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5192639

    ---

Associated Targets(Human)

AGTR2 Tchem Angiotensin II type 2 (AT-2) receptor (2549 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
AGTR1 Tclin Type-1 angiotensin II receptor (5176 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 476.62Molecular Weight (Monoisotopic): 476.1552AlogP: 4.35#Rotatable Bonds: 7
Polar Surface Area: 103.18Molecular Species: ACIDHBA: 8HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 4.57CX Basic pKa: 6.67CX LogP: 3.62CX LogD: 4.06
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.54Np Likeness Score: -1.19

References

1. Gopalan G, Palo-Nieto C, Petersen NN, Hallberg M, Larhed M..  (2022)  Angiotensin II AT2 receptor ligands with phenylthiazole scaffolds.,  65  [PMID:35550979] [10.1016/j.bmc.2022.116790]

Source