3-(2-(1H-indol-4-yl)-6-(1-methyl-1H-pyrazol-5-yl)quinazolin-4-yl)-8-oxa-3-azabicyclo[3.2.1]octane

ID: ALA5192689

PubChem CID: 168290085

Max Phase: Preclinical

Molecular Formula: C26H24N6O

Molecular Weight: 436.52

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cn1nccc1-c1ccc2nc(-c3cccc4[nH]ccc34)nc(N3CC4CCC(C3)O4)c2c1

Standard InChI:  InChI=1S/C26H24N6O/c1-31-24(10-12-28-31)16-5-8-23-21(13-16)26(32-14-17-6-7-18(15-32)33-17)30-25(29-23)20-3-2-4-22-19(20)9-11-27-22/h2-5,8-13,17-18,27H,6-7,14-15H2,1H3

Standard InChI Key:  QGABLSCWYDBZLR-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 39  0  0  0  0  0  0  0  0999 V2000
    2.4705    1.2078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1846    1.6209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1846    2.4449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4725    2.8521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7622    2.4395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7622    1.6197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0528    1.2098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3381    1.6231    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3697    1.2079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3697    0.3840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3403   -0.0246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0528    0.3859    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3403   -0.8439    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0513   -1.2527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0513   -2.0766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7488   -2.8521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0749   -2.8521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3722   -2.0784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3722   -1.2546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3876   -1.5855    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0818   -0.0237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7929    0.3840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7929    1.2079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0818    1.6240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5018   -0.0266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2498    0.3079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7982   -0.3024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3888   -1.0136    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5838   -0.8421    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9736   -1.3888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7982    1.0693    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.4633    0.3153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6426    0.4008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  6  7  1  0
  8  7  2  0
  9  8  1  0
 10  9  2  0
 10 11  1  0
  7 12  1  0
 12 11  2  0
 11 13  1  0
 14 13  1  0
 15 14  1  0
 15 16  1  0
 17 16  1  0
 18 17  1  0
 13 19  1  0
 19 18  1  0
 15 20  1  0
 18 20  1  0
 10 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
  9 24  1  0
 25 22  1  0
 26 25  2  0
 27 26  1  0
 28 27  2  0
 29 28  1  0
 29 25  1  0
 30 29  1  0
  2 31  1  0
 31 32  1  0
 32 33  2  0
  1 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5192689

    ---

Associated Targets(Human)

ATR Tchem Serine-protein kinase ATR (986 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 436.52Molecular Weight (Monoisotopic): 436.2012AlogP: 4.55#Rotatable Bonds: 3
Polar Surface Area: 71.86Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.56CX LogP: 4.81CX LogD: 4.81
Aromatic Rings: 5Heavy Atoms: 33QED Weighted: 0.45Np Likeness Score: -0.83

References

1. Bin H, Chen P, Wu M, Wang F, Lin G, Pan S, Liu J, Mu B, Nan J, Huang Q, Li L, Yang S..  (2022)  Discovery of a potent and highly selective inhibitor of ataxia telangiectasia mutated and Rad3-Related (ATR) kinase: Structural activity relationship and antitumor activity both in vitro and in vivo.,  232  [PMID:35183872] [10.1016/j.ejmech.2022.114187]

Source