The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
butyl 3-(4-(cyclopropylcarbamoyl)phenyl)-5-isobutylthiophen-2-ylsulfonylcarbamate ID: ALA519274
PubChem CID: 44567746
Max Phase: Preclinical
Molecular Formula: C23H30N2O5S2
Molecular Weight: 478.64
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCOC(=O)NS(=O)(=O)c1sc(CC(C)C)cc1-c1ccc(C(=O)NC2CC2)cc1
Standard InChI: InChI=1S/C23H30N2O5S2/c1-4-5-12-30-23(27)25-32(28,29)22-20(14-19(31-22)13-15(2)3)16-6-8-17(9-7-16)21(26)24-18-10-11-18/h6-9,14-15,18H,4-5,10-13H2,1-3H3,(H,24,26)(H,25,27)
Standard InChI Key: JIXDDBXAUJUWQY-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
2.0943 -1.1381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3774 -1.5403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3703 -2.3645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0820 -2.7837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8022 -2.3726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8057 -1.5497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0812 -3.6103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4106 -4.0907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6602 -4.8770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4852 -4.8826 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.7453 -4.0997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5317 -3.8501 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
4.3129 -3.5914 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.7861 -4.6348 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2791 -3.0647 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9291 -4.1401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7634 -4.9479 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7137 -3.8808 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3804 -5.4956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2146 -6.3037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8316 -6.8514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6659 -7.6596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1707 -5.5411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5012 -6.2971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0117 -6.9612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3210 -6.3889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0980 -0.3115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8151 0.0962 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.3862 0.1057 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8206 0.9212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2360 1.6290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4110 1.6345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10 11 1 0
11 7 2 0
4 7 1 0
11 12 1 0
12 13 1 0
12 14 2 0
12 15 2 0
13 16 1 0
16 17 1 0
16 18 2 0
17 19 1 0
1 2 2 0
19 20 1 0
20 21 1 0
2 3 1 0
21 22 1 0
9 23 1 0
3 4 2 0
23 24 1 0
24 25 1 0
4 5 1 0
24 26 1 0
5 6 2 0
6 1 1 0
27 28 1 0
27 29 2 0
1 27 1 0
7 8 1 0
28 30 1 0
31 30 1 0
32 31 1 0
30 32 1 0
8 9 2 0
9 10 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 478.64Molecular Weight (Monoisotopic): 478.1596AlogP: 4.72#Rotatable Bonds: 10Polar Surface Area: 101.57Molecular Species: ACIDHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 4.61CX Basic pKa: ┄CX LogP: 5.47CX LogD: 4.53Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.48Np Likeness Score: -0.69
References 1. Wallinder C, Botros M, Rosenström U, Guimond MO, Beaudry H, Nyberg F, Gallo-Payet N, Hallberg A, Alterman M.. (2008) Selective angiotensin II AT2 receptor agonists: Benzamide structure-activity relationships., 16 (14): [PMID:18599297 ] [10.1016/j.bmc.2008.05.066 ]