The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-2-(3-((1r,3S)-1-(5-((1S,2S)-1-amino-2-hydroxypropyl)-1,3,4-oxadiazol-2-yl)-3-(cyanomethyl)cyclobutyl)ureido)-3-hydroxypropanoic acid ID: ALA5192765
PubChem CID: 148426987
Max Phase: Preclinical
Molecular Formula: C15H22N6O6
Molecular Weight: 382.38
Associated Items:
Names and Identifiers Canonical SMILES: CC(O)[C@H](N)c1nnc([C@]2(NC(=O)N[C@@H](CO)C(=O)O)C[C@H](CC#N)C2)o1
Standard InChI: InChI=1S/C15H22N6O6/c1-7(23)10(17)11-20-21-13(27-11)15(4-8(5-15)2-3-16)19-14(26)18-9(6-22)12(24)25/h7-10,22-23H,2,4-6,17H2,1H3,(H,24,25)(H2,18,19,26)/t7?,8-,9-,10-,15-/m0/s1
Standard InChI Key: LWSKBIOOWYDZLY-LJIPGFBNSA-N
Molfile:
RDKit 2D
27 28 0 0 0 0 0 0 0 0999 V2000
-1.2702 -0.9667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.5174 -1.7538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8462 -2.2484 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.1891 -1.7751 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.4406 -0.9667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0260 -0.2485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8032 -0.2485 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2179 0.4696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0473 0.4696 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4619 1.1879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2913 1.1879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7060 1.9061 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7060 0.4696 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0473 1.9061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2179 1.9061 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.8032 1.1879 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0260 0.5810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8695 0.5810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8695 -0.2485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4560 1.1674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2413 1.9685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0267 2.7695 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.3184 -1.9684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5331 -2.7695 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.9049 -1.3820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7060 -1.5967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6902 -0.5809 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
4 3 1 0
5 4 2 0
1 5 1 0
5 6 1 0
6 7 1 1
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
11 13 2 0
10 14 1 1
14 15 1 0
8 16 2 0
6 17 1 0
17 18 1 0
19 18 1 0
6 19 1 0
18 20 1 6
20 21 1 0
21 22 3 0
2 23 1 0
23 24 1 0
23 25 1 1
25 26 1 0
25 27 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 382.38Molecular Weight (Monoisotopic): 382.1601AlogP: -1.29#Rotatable Bonds: 8Polar Surface Area: 207.62Molecular Species: ACIDHBA: 9HBD: 6#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 7#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.25CX Basic pKa: 6.74CX LogP: -5.65CX LogD: -6.29Aromatic Rings: 1Heavy Atoms: 27QED Weighted: 0.31Np Likeness Score: -0.14
References 1. Pan C, Yang H, Lu Y, Hu S, Wu Y, He Q, Dong X.. (2021) Recent advance of peptide-based molecules and nonpeptidic small-molecules modulating PD-1/PD-L1 protein-protein interaction or targeting PD-L1 protein degradation., 213 [PMID:33454550 ] [10.1016/j.ejmech.2021.113170 ]