The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Diethyl ((E)-3-(3-nitrophenyl)acryloyl)glycyl-L-valyl-D-glutamate ID: ALA5192766
PubChem CID: 168286568
Max Phase: Preclinical
Molecular Formula: C25H34N4O9
Molecular Weight: 534.57
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)CC[C@@H](NC(=O)[C@@H](NC(=O)CNC(=O)/C=C/c1cccc([N+](=O)[O-])c1)C(C)C)C(=O)OCC
Standard InChI: InChI=1S/C25H34N4O9/c1-5-37-22(32)13-11-19(25(34)38-6-2)27-24(33)23(16(3)4)28-21(31)15-26-20(30)12-10-17-8-7-9-18(14-17)29(35)36/h7-10,12,14,16,19,23H,5-6,11,13,15H2,1-4H3,(H,26,30)(H,27,33)(H,28,31)/b12-10+/t19-,23+/m1/s1
Standard InChI Key: CCLWYLXIFKFKRH-XSIWJGCBSA-N
Molfile:
RDKit 2D
38 38 0 0 0 0 0 0 0 0999 V2000
-2.5219 0.4488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8074 0.8614 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5219 -0.3764 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.2366 0.8614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9513 0.4488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6661 0.8614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3809 0.4490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.0931 0.8611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.0931 1.6866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3827 2.0985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6661 1.6903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0927 0.4487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3780 0.8614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3366 0.4487 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.3780 1.6866 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0513 0.8614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7660 0.4487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0513 1.6866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4807 0.8614 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7660 -0.3765 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1954 0.4487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9101 0.8614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6248 0.4487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3395 0.8614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0542 0.4487 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7689 0.8614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1954 -0.3765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9101 -0.7891 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4807 -0.7891 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9101 -1.6144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2428 -2.0992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5224 0.5258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3395 1.6866 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7660 2.0992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3366 2.0992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.8078 0.4484 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.8078 -0.3767 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.5224 0.8611 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 2 0
1 4 1 0
4 5 2 0
5 6 1 0
7 6 2 0
8 7 1 0
9 8 2 0
10 9 1 0
11 10 2 0
6 11 1 0
2 12 1 0
12 13 1 0
13 14 1 0
13 15 2 0
14 16 1 0
16 17 1 0
16 18 1 1
17 19 1 0
17 20 2 0
19 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
21 27 1 6
27 28 1 0
27 29 2 0
28 30 1 0
31 30 1 0
32 26 1 0
24 33 2 0
34 18 1 0
18 35 1 0
8 36 1 0
36 37 1 0
36 38 2 0
M CHG 2 36 1 37 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 534.57Molecular Weight (Monoisotopic): 534.2326AlogP: 1.26#Rotatable Bonds: 15Polar Surface Area: 183.04Molecular Species: NEUTRALHBA: 9HBD: 3#RO5 Violations: 1HBA (Lipinski): 13HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.73CX Basic pKa: ┄CX LogP: 1.44CX LogD: 1.44Aromatic Rings: 1Heavy Atoms: 38QED Weighted: 0.13Np Likeness Score: -0.67