Diethyl ((E)-3-(3-nitrophenyl)acryloyl)glycyl-L-valyl-D-glutamate

ID: ALA5192766

PubChem CID: 168286568

Max Phase: Preclinical

Molecular Formula: C25H34N4O9

Molecular Weight: 534.57

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCOC(=O)CC[C@@H](NC(=O)[C@@H](NC(=O)CNC(=O)/C=C/c1cccc([N+](=O)[O-])c1)C(C)C)C(=O)OCC

Standard InChI:  InChI=1S/C25H34N4O9/c1-5-37-22(32)13-11-19(25(34)38-6-2)27-24(33)23(16(3)4)28-21(31)15-26-20(30)12-10-17-8-7-9-18(14-17)29(35)36/h7-10,12,14,16,19,23H,5-6,11,13,15H2,1-4H3,(H,26,30)(H,27,33)(H,28,31)/b12-10+/t19-,23+/m1/s1

Standard InChI Key:  CCLWYLXIFKFKRH-XSIWJGCBSA-N

Molfile:  

 
     RDKit          2D

 38 38  0  0  0  0  0  0  0  0999 V2000
   -2.5219    0.4488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8074    0.8614    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5219   -0.3764    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2366    0.8614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9513    0.4488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6661    0.8614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3809    0.4490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0931    0.8611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0931    1.6866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3827    2.0985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6661    1.6903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0927    0.4487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3780    0.8614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3366    0.4487    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3780    1.6866    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0513    0.8614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7660    0.4487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0513    1.6866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4807    0.8614    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7660   -0.3765    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1954    0.4487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9101    0.8614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6248    0.4487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3395    0.8614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0542    0.4487    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7689    0.8614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1954   -0.3765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9101   -0.7891    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4807   -0.7891    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9101   -1.6144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2428   -2.0992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5224    0.5258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3395    1.6866    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7660    2.0992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3366    2.0992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8078    0.4484    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8078   -0.3767    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5224    0.8611    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  2  0
  1  4  1  0
  4  5  2  0
  5  6  1  0
  7  6  2  0
  8  7  1  0
  9  8  2  0
 10  9  1  0
 11 10  2  0
  6 11  1  0
  2 12  1  0
 12 13  1  0
 13 14  1  0
 13 15  2  0
 14 16  1  0
 16 17  1  0
 16 18  1  1
 17 19  1  0
 17 20  2  0
 19 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 21 27  1  6
 27 28  1  0
 27 29  2  0
 28 30  1  0
 31 30  1  0
 32 26  1  0
 24 33  2  0
 34 18  1  0
 18 35  1  0
  8 36  1  0
 36 37  1  0
 36 38  2  0
M  CHG  2  36   1  37  -1
M  END

Alternative Forms

  1. Parent:

    ALA5192766

    ---

Associated Targets(Human)

NOD2 Tclin Nucleotide-binding oligomerization domain-containing protein 2 (1613 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
NOD1 Tchem Nucleotide-binding oligomerization domain-containing protein 1 (1322 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 534.57Molecular Weight (Monoisotopic): 534.2326AlogP: 1.26#Rotatable Bonds: 15
Polar Surface Area: 183.04Molecular Species: NEUTRALHBA: 9HBD: 3
#RO5 Violations: 1HBA (Lipinski): 13HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 11.73CX Basic pKa: CX LogP: 1.44CX LogD: 1.44
Aromatic Rings: 1Heavy Atoms: 38QED Weighted: 0.13Np Likeness Score: -0.67

References

1. Guzelj S, Bizjak Š, Jakopin Ž..  (2022)  Discovery of Desmuramylpeptide NOD2 Agonists with Single-Digit Nanomolar Potency.,  13  (8.0): [PMID:35978688] [10.1021/acsmedchemlett.2c00121]

Source