4-(4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl)butyl 4-carbamothioylbenzoate

ID: ALA5192985

PubChem CID: 168285779

Max Phase: Preclinical

Molecular Formula: C23H27ClN2O3S

Molecular Weight: 447.00

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  NC(=S)c1ccc(C(=O)OCCCCN2CCC(O)(c3ccc(Cl)cc3)CC2)cc1

Standard InChI:  InChI=1S/C23H27ClN2O3S/c24-20-9-7-19(8-10-20)23(28)11-14-26(15-12-23)13-1-2-16-29-22(27)18-5-3-17(4-6-18)21(25)30/h3-10,28H,1-2,11-16H2,(H2,25,30)

Standard InChI Key:  IHAPRJBOWKJZEK-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 32  0  0  0  0  0  0  0  0999 V2000
   -5.0157    2.4888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8020    3.2856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0074    3.4977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4239    2.9143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6348    2.1210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4299    1.9031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3855    3.8691    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -3.0514    1.5376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2544    1.7512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6710    1.1677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8845    0.3707    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6815    0.1571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2650    0.7405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8378    2.3346    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3010   -0.2128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5040    0.0007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0794   -0.5826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8764   -0.3691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4598   -0.9525    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.2569   -0.7389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8403   -1.3224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4704    0.0580    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6375   -1.1091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2186   -1.6913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0050   -2.4886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2124   -2.7026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6258   -2.1228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5885   -3.0721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3855   -2.8585    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    4.3749   -3.8691    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  2  7  1  0
  5  8  1  0
  9  8  1  0
 10  9  1  0
 11 10  1  0
 12 11  1  0
 13 12  1  0
  8 13  1  0
  8 14  1  0
 11 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 20 22  2  0
 23 21  2  0
 24 23  1  0
 25 24  2  0
 26 25  1  0
 27 26  2  0
 21 27  1  0
 25 28  1  0
 28 29  2  0
 28 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5192985

    ---

Associated Targets(non-human)

Tmem97 Sigma intracellular receptor 2 (922 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SIGMAR1 Sigma-1 receptor (3326 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Oprm1 Mu opioid receptor (6060 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Oprd1 Delta opioid receptor (3911 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
OPRK1 Kappa opioid receptor (4577 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 447.00Molecular Weight (Monoisotopic): 446.1431AlogP: 3.89#Rotatable Bonds: 8
Polar Surface Area: 75.79Molecular Species: BASEHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 11.78CX Basic pKa: 8.99CX LogP: 3.88CX LogD: 2.28
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.36Np Likeness Score: -0.72

References

1. Dichiara M, Artacho-Cordón A, Turnaturi R, Santos-Caballero M, González-Cano R, Pasquinucci L, Barbaraci C, Rodríguez-Gómez I, Gómez-Guzmán M, Marrazzo A, Cobos EJ, Amata E..  (2022)  Dual Sigma-1 receptor antagonists and hydrogen sulfide-releasing compounds for pain treatment: Design, synthesis, and pharmacological evaluation.,  230  [PMID:35016113] [10.1016/j.ejmech.2021.114091]

Source