3-(((S)-3-((S)-3-(((S)-1-Amino-1-oxo-3-phenylpropan-2-yl)-carbamoyl)-3,4-dihydroisoquinolin-2(1H)-yl)-2-((S)-2-(methylamino)propanamido)-3-oxopropyl)carbamoyl)-4-methoxybenzenesulfonyl Fluoride

ID: ALA5193194

PubChem CID: 168287021

Max Phase: Preclinical

Molecular Formula: C34H39FN6O8S

Molecular Weight: 710.79

Associated Items:

Names and Identifiers

Canonical SMILES:  CN[C@@H](C)C(=O)N[C@@H](CNC(=O)c1cc(S(=O)(=O)F)ccc1OC)C(=O)N1Cc2ccccc2C[C@H]1C(=O)N[C@@H](Cc1ccccc1)C(N)=O

Standard InChI:  InChI=1S/C34H39FN6O8S/c1-20(37-2)31(43)40-27(18-38-32(44)25-17-24(50(35,47)48)13-14-29(25)49-3)34(46)41-19-23-12-8-7-11-22(23)16-28(41)33(45)39-26(30(36)42)15-21-9-5-4-6-10-21/h4-14,17,20,26-28,37H,15-16,18-19H2,1-3H3,(H2,36,42)(H,38,44)(H,39,45)(H,40,43)/t20-,26-,27-,28-/m0/s1

Standard InChI Key:  JUOKIFQCAPGRNU-PFCIVCCVSA-N

Molfile:  

 
     RDKit          2D

 50 53  0  0  0  0  0  0  0  0999 V2000
   27.8421  -12.8954    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   28.5566  -12.4829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1276  -12.4829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5566  -11.6579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2710  -12.8954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2710  -13.7204    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.9855  -12.4829    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   30.7000  -12.8954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4144  -12.4829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.4144  -11.6579    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.7000  -13.7204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9855  -14.1329    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.9855  -14.9579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2710  -15.3704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.7000  -15.3704    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   28.5594  -14.9503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8459  -15.3581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8422  -16.1857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5604  -16.5995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2725  -16.1866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9870  -16.5991    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   29.9870  -17.4233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8500  -11.6535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5638  -11.2414    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.1348  -11.2406    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.2778  -11.6537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9925  -11.2411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7069  -11.6536    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   34.9925  -10.4160    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.2778  -12.4785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9924  -12.8911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.9892  -13.7145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7021  -14.1273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4176  -13.7155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.4156  -12.8866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.7020  -12.4775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8500  -12.4785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.1290  -12.8954    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   32.1290  -13.7246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5732  -12.8908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5715  -13.7263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8509  -14.1397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.8497  -14.9686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.5683  -15.3849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2896  -14.9664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.2872  -14.1389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1315  -14.9456    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   27.1315  -14.1206    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   26.3065  -14.9456    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.7190  -15.6600    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  1  0
  2  4  1  1
  2  5  1  0
  5  6  2  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  9 38  1  0
  9 10  2  0
  8 11  1  6
 11 12  1  0
 12 13  1  0
 13 14  1  0
 13 15  2  0
 14 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 14  1  0
 20 21  1  0
 21 22  1  0
 37 23  1  6
 23 24  1  0
 23 25  2  0
 24 26  1  0
 26 27  1  0
 27 28  1  0
 27 29  2  0
 26 30  1  6
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 31  1  0
 37 38  1  0
 37 40  1  0
 38 39  1  0
 39 42  1  0
 41 40  1  0
 41 42  2  0
 42 43  1  0
 43 44  2  0
 44 45  1  0
 45 46  2  0
 46 41  1  0
 47 48  1  0
 47 50  2  0
 47 49  2  0
 17 47  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5193194

    ---

Associated Targets(Human)

BIRC7 Tchem Baculoviral IAP repeat-containing protein 7 (64 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
XIAP Tchem Inhibitor of apoptosis protein 3 (3673 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
BIRC2 Tchem Baculoviral IAP repeat-containing protein 2 (984 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
BIRC3 Tchem Baculoviral IAP repeat-containing protein 3 (320 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 710.79Molecular Weight (Monoisotopic): 710.2534AlogP: 0.34#Rotatable Bonds: 14
Polar Surface Area: 206.10Molecular Species: BASEHBA: 9HBD: 5
#RO5 Violations: 1HBA (Lipinski): 14HBD (Lipinski): 6#RO5 Violations (Lipinski): 3
CX Acidic pKa: 11.47CX Basic pKa: 8.60CX LogP: 0.75CX LogD: -0.48
Aromatic Rings: 3Heavy Atoms: 50QED Weighted: 0.15Np Likeness Score: -0.50

References

1. Udompholkul P, Baggio C, Gambini L, Alboreggia G, Pellecchia M..  (2021)  Lysine Covalent Antagonists of Melanoma Inhibitors of Apoptosis Protein.,  64  (21.0): [PMID:34705456] [10.1021/acs.jmedchem.1c01459]

Source