The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
methyl (2S)-2-[[4-[[(2S)-2-amino-3-sulfanyl-propyl]amino]-2-phenyl-benzoyl]amino]-4-methylsulfanyl-butanoate ID: ALA5193232
PubChem CID: 124514369
Max Phase: Preclinical
Molecular Formula: C22H29N3O3S2
Molecular Weight: 447.63
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)[C@H](CCSC)NC(=O)c1ccc(NC[C@H](N)CS)cc1-c1ccccc1
Standard InChI: InChI=1S/C22H29N3O3S2/c1-28-22(27)20(10-11-30-2)25-21(26)18-9-8-17(24-13-16(23)14-29)12-19(18)15-6-4-3-5-7-15/h3-9,12,16,20,24,29H,10-11,13-14,23H2,1-2H3,(H,25,26)/t16-,20-/m0/s1
Standard InChI Key: GKFPROVOIQKYTO-JXFKEZNVSA-N
Molfile:
RDKit 2D
30 31 0 0 0 0 0 0 0 0999 V2000
-1.4279 1.0319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7133 1.4442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0013 1.0323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0013 0.2072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7115 -0.2045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4279 0.2035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7131 1.4449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7134 2.2702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4263 2.6809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1411 2.2682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1427 1.4471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4309 1.0306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7131 -0.2054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4278 0.2072 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1425 -0.2054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7131 -1.0305 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8571 0.2072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5717 -0.2054 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8571 1.0323 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2864 0.2072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1425 -1.0305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8571 -1.4432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8571 -2.2683 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.5717 -2.6809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1425 1.4446 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.8571 1.0319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5718 1.4446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2864 1.0319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5718 2.2697 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.2864 0.2068 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
7 3 1 0
8 7 2 0
9 8 1 0
10 9 2 0
11 10 1 0
7 12 1 0
12 11 2 0
4 13 1 0
13 14 1 0
14 15 1 0
13 16 2 0
15 17 1 0
17 18 1 0
17 19 2 0
18 20 1 0
15 21 1 6
21 22 1 0
22 23 1 0
23 24 1 0
1 25 1 0
25 26 1 0
26 27 1 0
27 28 1 1
27 29 1 0
28 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 447.63Molecular Weight (Monoisotopic): 447.1650AlogP: 3.05#Rotatable Bonds: 11Polar Surface Area: 93.45Molecular Species: BASEHBA: 7HBD: 4#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.25CX Basic pKa: 9.26CX LogP: 2.47CX LogD: 0.85Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.31Np Likeness Score: -0.73