The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-benzyl-1-(4-((5-cyanopyridin-2-yl)amino)cyclohexyl)-1-(4-(1-methyl-6-oxo-1,6-dihydropyridin-3-yl)phenyl)urea ID: ALA5193291
Max Phase: Preclinical
Molecular Formula: C32H32N6O2
Molecular Weight: 532.65
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cn1cc(-c2ccc(N(C(=O)NCc3ccccc3)C3CCC(Nc4ccc(C#N)cn4)CC3)cc2)ccc1=O
Standard InChI: InChI=1S/C32H32N6O2/c1-37-22-26(10-18-31(37)39)25-8-13-28(14-9-25)38(32(40)35-20-23-5-3-2-4-6-23)29-15-11-27(12-16-29)36-30-17-7-24(19-33)21-34-30/h2-10,13-14,17-18,21-22,27,29H,11-12,15-16,20H2,1H3,(H,34,36)(H,35,40)
Standard InChI Key: HDJBGURZVALLMD-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
1.4295 -0.8244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1441 -0.4121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8559 -0.8240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8559 -1.6492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1458 -2.0609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4295 -1.6529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7148 -0.4118 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0002 -0.8244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0002 -1.6496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7143 -2.0621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4290 -1.6496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4290 -0.8244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7143 -0.4118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1436 -2.0621 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.8582 -1.6496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5730 -2.0620 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.2852 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2852 -0.8245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5748 -0.4126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8582 -0.8208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9997 -0.4119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7144 0.0005 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.7148 0.4133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0002 0.8259 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4295 0.8259 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4295 1.6511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1441 2.0637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1443 2.8889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8572 3.2996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5721 2.8868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5736 2.0658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8618 1.6493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5706 -2.0618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2852 -1.6492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9997 -2.0618 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.9997 -2.8870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2852 -3.2996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5706 -2.8870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7144 -1.6492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7144 -3.2996 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
1 7 1 0
7 8 1 0
9 8 1 0
10 9 1 0
11 10 1 0
12 11 1 0
13 12 1 0
8 13 1 0
11 14 1 0
14 15 1 0
16 15 2 0
17 16 1 0
18 17 2 0
19 18 1 0
20 19 2 0
15 20 1 0
21 18 1 0
21 22 3 0
7 23 1 0
23 24 2 0
23 25 1 0
25 26 1 0
26 27 1 0
28 27 2 0
29 28 1 0
30 29 2 0
31 30 1 0
32 31 2 0
27 32 1 0
33 4 1 0
33 34 2 0
35 34 1 0
36 35 1 0
37 36 1 0
33 38 1 0
38 37 2 0
35 39 1 0
36 40 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 532.65Molecular Weight (Monoisotopic): 532.2587AlogP: 5.46#Rotatable Bonds: 7Polar Surface Area: 103.05Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 2.70CX LogP: 4.08CX LogD: 4.08Aromatic Rings: 4Heavy Atoms: 40QED Weighted: 0.33Np Likeness Score: -1.51
References 1. Lei P, Zhang J, Liao P, Ren C, Wang J, Wang Y.. (2022) Current progress and novel strategies that target CDK12 for drug discovery., 240 [PMID:35868123 ] [10.1016/j.ejmech.2022.114603 ]