The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(2-(3-chloro-4-methoxyphenethyl)-1-(((trans)-4-methoxycyclohexyl)-1H-benzo[d]imidazol-5-yl)-3,5-dimethylisoxazole ID: ALA5193321
PubChem CID: 168286167
Max Phase: Preclinical
Molecular Formula: C28H32ClN3O3
Molecular Weight: 494.04
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(CCc2nc3cc(-c4c(C)noc4C)ccc3n2[C@H]2CC[C@H](OC)CC2)cc1Cl
Standard InChI: InChI=1S/C28H32ClN3O3/c1-17-28(18(2)35-31-17)20-7-12-25-24(16-20)30-27(32(25)21-8-10-22(33-3)11-9-21)14-6-19-5-13-26(34-4)23(29)15-19/h5,7,12-13,15-16,21-22H,6,8-11,14H2,1-4H3/t21-,22-
Standard InChI Key: YCBRAVWUAMYMQN-HZCBDIJESA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
-2.8152 -0.6887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1006 -0.2764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3887 -0.6883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3887 -1.5135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0988 -1.9253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8152 -1.5172 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5846 -0.4382 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.1137 -1.0918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6058 -1.7594 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.7113 -1.0918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1240 -1.8064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9491 -1.8064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3710 0.3588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3620 -1.0919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1847 -1.0927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5974 -1.8075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1882 -2.5194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3635 -2.5242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5973 -0.3780 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
4.4226 -1.8075 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8352 -1.0929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5298 -1.9298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6161 -2.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4228 -2.9216 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.8352 -2.2073 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.2833 -1.5943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4969 -0.7972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0325 -3.3335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9545 0.9423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7409 1.7394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0561 1.9530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6396 1.3695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4260 0.5724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2697 2.7500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3137 3.3335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
3 7 1 0
7 8 1 0
9 8 2 0
4 9 1 0
8 10 1 0
10 11 1 0
11 12 1 0
13 7 1 1
14 12 2 0
15 14 1 0
16 15 2 0
17 16 1 0
18 17 2 0
12 18 1 0
15 19 1 0
16 20 1 0
20 21 1 0
6 22 1 0
23 22 2 0
23 24 1 0
24 25 1 0
25 26 2 0
26 22 1 0
26 27 1 0
23 28 1 0
29 13 1 0
30 29 1 0
31 30 1 0
32 31 1 0
33 32 1 0
13 33 1 0
31 34 1 6
34 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 494.04Molecular Weight (Monoisotopic): 493.2132AlogP: 6.89#Rotatable Bonds: 7Polar Surface Area: 62.31Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 5.60CX LogP: 5.73CX LogD: 5.72Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.28Np Likeness Score: -1.10
References 1. Chen Z, Li J, Yang H, He Y, Shi Q, Chang Q, Liu R, Huang X, Li Y.. (2022) Discovery of novel benzimidazole derivatives as potent p300 bromodomain inhibitors with anti-proliferative activity in multiple cancer cells., 66 [PMID:35569250 ] [10.1016/j.bmc.2022.116784 ]