The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Ethyl 3-(2-(benzo[d]oxazol-2-ylamino)-4-(2-chlorophenyl)-6-methyl-1,4-dihydropyrimidine-5-carboxamido)benzoate ID: ALA5193395
PubChem CID: 73336305
Max Phase: Preclinical
Molecular Formula: C28H24ClN5O4
Molecular Weight: 529.98
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)c1cccc(NC(=O)C2=C(C)NC(Nc3nc4ccccc4o3)=NC2c2ccccc2Cl)c1
Standard InChI: InChI=1S/C28H24ClN5O4/c1-3-37-26(36)17-9-8-10-18(15-17)31-25(35)23-16(2)30-27(33-24(23)19-11-4-5-12-20(19)29)34-28-32-21-13-6-7-14-22(21)38-28/h4-15,24H,3H2,1-2H3,(H,31,35)(H2,30,32,33,34)
Standard InChI Key: VLAUTIPAOSIACQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
15.4055 -17.6108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4044 -18.4304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1124 -18.8393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8221 -18.4299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8193 -17.6072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1106 -17.2020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1122 -19.6565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3992 -20.0611 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.3971 -20.8747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1029 -21.2873 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.8125 -20.8801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8163 -20.0603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5187 -21.2913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.5244 -19.6523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2317 -20.0615 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.5251 -18.8351 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.6877 -21.2804 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.9817 -20.8690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9025 -20.0587 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.2368 -21.2011 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.6924 -20.5917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1047 -19.8889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7023 -19.1826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8878 -19.1777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4773 -19.8852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8820 -20.5887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6964 -18.8384 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
18.9398 -19.6535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6435 -20.0637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3510 -19.6564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.3522 -18.8383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6398 -18.4293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9352 -18.8389 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0582 -20.0659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0571 -20.8831 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.7665 -19.6583 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
22.4736 -20.0678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1819 -19.6602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
3 7 1 0
7 8 1 0
7 12 1 0
8 9 2 0
9 10 1 0
10 11 1 0
11 12 2 0
11 13 1 0
12 14 1 0
14 15 1 0
14 16 2 0
9 17 1 0
17 18 1 0
18 19 2 0
19 22 1 0
21 20 1 0
20 18 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
2 27 1 0
15 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
30 34 1 0
34 35 2 0
34 36 1 0
36 37 1 0
37 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 529.98Molecular Weight (Monoisotopic): 529.1517AlogP: 5.68#Rotatable Bonds: 6Polar Surface Area: 117.85Molecular Species: NEUTRALHBA: 8HBD: 3#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 9.61CX Basic pKa: 3.62CX LogP: 5.30CX LogD: 5.30Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.27Np Likeness Score: -1.17
References 1. Liu L, Tang M, Pragani R, Whitby FG, Zhang YQ, Balakrishnan B, Fang Y, Karavadhi S, Tao D, LeClair CA, Hall MD, Marugan JJ, Boxer M, Shen M, Hill CP, Lai K, Patnaik S.. (2021) Structure-Based Optimization of Small Molecule Human Galactokinase Inhibitors., 64 (18.0): [PMID:34491744 ] [10.1021/acs.jmedchem.1c00945 ]