Ethyl 3-(2-(benzo[d]oxazol-2-ylamino)-4-(2-chlorophenyl)-6-methyl-1,4-dihydropyrimidine-5-carboxamido)benzoate

ID: ALA5193395

PubChem CID: 73336305

Max Phase: Preclinical

Molecular Formula: C28H24ClN5O4

Molecular Weight: 529.98

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCOC(=O)c1cccc(NC(=O)C2=C(C)NC(Nc3nc4ccccc4o3)=NC2c2ccccc2Cl)c1

Standard InChI:  InChI=1S/C28H24ClN5O4/c1-3-37-26(36)17-9-8-10-18(15-17)31-25(35)23-16(2)30-27(33-24(23)19-11-4-5-12-20(19)29)34-28-32-21-13-6-7-14-22(21)38-28/h4-15,24H,3H2,1-2H3,(H,31,35)(H2,30,32,33,34)

Standard InChI Key:  VLAUTIPAOSIACQ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
   15.4055  -17.6108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4044  -18.4304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1124  -18.8393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8221  -18.4299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8193  -17.6072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1106  -17.2020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1122  -19.6565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3992  -20.0611    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.3971  -20.8747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1029  -21.2873    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.8125  -20.8801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8163  -20.0603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5187  -21.2913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5244  -19.6523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2317  -20.0615    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.5251  -18.8351    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.6877  -21.2804    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.9817  -20.8690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9025  -20.0587    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.2368  -21.2011    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.6924  -20.5917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1047  -19.8889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7023  -19.1826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8878  -19.1777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4773  -19.8852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8820  -20.5887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6964  -18.8384    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   18.9398  -19.6535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6435  -20.0637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3510  -19.6564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.3522  -18.8383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6398  -18.4293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9352  -18.8389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0582  -20.0659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0571  -20.8831    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.7665  -19.6583    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.4736  -20.0678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.1819  -19.6602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  3  7  1  0
  7  8  1  0
  7 12  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 11 13  1  0
 12 14  1  0
 14 15  1  0
 14 16  2  0
  9 17  1  0
 17 18  1  0
 18 19  2  0
 19 22  1  0
 21 20  1  0
 20 18  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
  2 27  1  0
 15 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
 30 34  1  0
 34 35  2  0
 34 36  1  0
 36 37  1  0
 37 38  1  0
M  END

Associated Targets(Human)

GALK1 Tbio Galactokinase (959 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 529.98Molecular Weight (Monoisotopic): 529.1517AlogP: 5.68#Rotatable Bonds: 6
Polar Surface Area: 117.85Molecular Species: NEUTRALHBA: 8HBD: 3
#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 9.61CX Basic pKa: 3.62CX LogP: 5.30CX LogD: 5.30
Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.27Np Likeness Score: -1.17

References

1. Liu L, Tang M, Pragani R, Whitby FG, Zhang YQ, Balakrishnan B, Fang Y, Karavadhi S, Tao D, LeClair CA, Hall MD, Marugan JJ, Boxer M, Shen M, Hill CP, Lai K, Patnaik S..  (2021)  Structure-Based Optimization of Small Molecule Human Galactokinase Inhibitors.,  64  (18.0): [PMID:34491744] [10.1021/acs.jmedchem.1c00945]

Source