2-(1-amino-2-(1H-imidazol-5-yl)ethyl)-6-phenylquinazolin-4(3H)-one

ID: ALA5193472

PubChem CID: 168284637

Max Phase: Preclinical

Molecular Formula: C19H17N5O

Molecular Weight: 331.38

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  NC(Cc1cnc[nH]1)c1nc2ccc(-c3ccccc3)cc2c(=O)[nH]1

Standard InChI:  InChI=1S/C19H17N5O/c20-16(9-14-10-21-11-22-14)18-23-17-7-6-13(8-15(17)19(25)24-18)12-4-2-1-3-5-12/h1-8,10-11,16H,9,20H2,(H,21,22)(H,23,24,25)

Standard InChI Key:  MSQRWTZUUURCRC-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 25 28  0  0  0  0  0  0  0  0999 V2000
   -1.7244    0.9087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0098    1.3210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2979    0.9091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2979    0.0839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0080   -0.3278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7244    0.0802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4391    1.3212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1539    0.9089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8659    1.3209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8659    2.1463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1556    2.5582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4391    2.1500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4166    1.3217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1313    0.9090    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.1313    0.0839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4166   -0.3286    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.4166    2.1468    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8459   -0.3286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5605    0.0839    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8459   -1.1538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5605   -1.5664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3140   -1.2309    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8659   -1.8439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4536   -2.5582    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6468   -2.3867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  7  1  1  0
  8  7  2  0
  9  8  1  0
 10  9  2  0
 11 10  1  0
  7 12  1  0
 12 11  2  0
  3 13  1  0
 14 13  1  0
 15 14  1  0
 16 15  2  0
  4 16  1  0
 13 17  2  0
 15 18  1  0
 18 19  1  0
 18 20  1  0
 20 21  1  0
 22 21  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 21  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5193472

    ---

Associated Targets(Human)

GPR39 Tchem G-protein coupled receptor 39 (216 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 331.38Molecular Weight (Monoisotopic): 331.1433AlogP: 2.56#Rotatable Bonds: 4
Polar Surface Area: 100.45Molecular Species: NEUTRALHBA: 4HBD: 3
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 9.66CX Basic pKa: 8.02CX LogP: 1.14CX LogD: 0.48
Aromatic Rings: 4Heavy Atoms: 25QED Weighted: 0.53Np Likeness Score: -0.79

References

1. Burley R, Hewer RC, Teall M, Dickson L, Ossola B, Russell S, Bender C, Cheung T, Powell JAC, Xu X, Brice NL, Otter L, Arimont M, Kidd SL, Vidal D, Dale JW, Mervin L, Sore HF, Mateu N, Lakshminarayana N, Dawson LA, Carlton M, Bürli RW..  (2022)  Synthesis and SAR of novel GPR39 agonists and positive allosteric modulators.,  61  [PMID:35123006] [10.1016/j.bmcl.2022.128607]

Source