2-((5-((3-(dimethylamino)phenoxy)methyl)-4-phenyl-4H-1,2,4-triazol-3-yl)thio)-N-(4-ethoxyphenyl)acetamide

ID: ALA5193528

PubChem CID: 1313921

Max Phase: Preclinical

Molecular Formula: C27H29N5O3S

Molecular Weight: 503.63

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOc1ccc(NC(=O)CSc2nnc(COc3cccc(N(C)C)c3)n2-c2ccccc2)cc1

Standard InChI:  InChI=1S/C27H29N5O3S/c1-4-34-23-15-13-20(14-16-23)28-26(33)19-36-27-30-29-25(32(27)21-9-6-5-7-10-21)18-35-24-12-8-11-22(17-24)31(2)3/h5-17H,4,18-19H2,1-3H3,(H,28,33)

Standard InChI Key:  WNPIKLCLJQAUEJ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
    0.5069   -0.6597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2800   -0.4122    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8878   -0.9702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6749   -0.7228    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8541    0.0824    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2827   -1.2807    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0699   -1.0333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2491   -0.2280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0363    0.0193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6442   -0.5384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4312   -0.2910    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0391   -0.8490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8261   -0.6015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4648   -1.3439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6777   -1.5913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7694   -1.4419    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.5945   -1.4340    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8419   -0.6468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6241   -0.3844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2425   -0.9306    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0248   -0.6681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6433   -1.2142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4254   -0.9517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0439   -1.4980    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.8801   -2.3066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8261   -1.2354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5892   -0.1431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9708    0.4029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1886    0.1404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1697   -0.1683    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.1618    0.6565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8724    1.0759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8645    1.9009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1460    2.3066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4355    1.8872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4434    1.0622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  4  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 10 14  2  0
 14 15  1  0
 15  7  2  0
  1 16  2  0
 16 17  1  0
 18 17  2  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  1  0
 24 26  1  0
 23 27  1  0
 27 28  2  0
 28 29  1  0
 29 21  2  0
  1 30  1  0
 30 18  1  0
 30 31  1  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 31  2  0
M  END

Associated Targets(non-human)

Ebolavirus (617 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Zaire ebolavirus (77 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 503.63Molecular Weight (Monoisotopic): 503.1991AlogP: 5.04#Rotatable Bonds: 11
Polar Surface Area: 81.51Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 3.86CX LogP: 4.64CX LogD: 4.64
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.29Np Likeness Score: -2.38

References

1. Morales-Tenorio M, Ginex T, Cuesta-Geijo MÁ, Campillo NE, Muñoz-Fontela C, Alonso C, Delgado R, Gil C..  (2021)  Potential pharmacological strategies targeting the Niemann-Pick C1 receptor and Ebola virus glycoprotein interaction.,  223  [PMID:34175537] [10.1016/j.ejmech.2021.113654]

Source