The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Moxalactam ID: ALA519374
PubChem CID: 5488645
Max Phase: Preclinical
Molecular Formula: C20H20N6O9S
Molecular Weight: 520.48
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CO[C@@]1(NC(=O)[C@H](C(=O)O)c2ccc(O)cc2)C(=O)N2C(C(=O)O)=C(CSc3nnnn3C)CO[C@@H]21
Standard InChI: InChI=1S/C20H20N6O9S/c1-25-19(22-23-24-25)36-8-10-7-35-18-20(34-2,17(33)26(18)13(10)16(31)32)21-14(28)12(15(29)30)9-3-5-11(27)6-4-9/h3-6,12,18,27H,7-8H2,1-2H3,(H,21,28)(H,29,30)(H,31,32)/t12-,18-,20+/m1/s1
Standard InChI Key: JWCSIUVGFCSJCK-LIUKBUMOSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
6.2074 -13.9088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3902 -13.0916 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.2074 -13.0874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3902 -13.9088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9131 -13.4878 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8490 -12.6830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6803 -12.6706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0813 -12.9554 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8242 -11.8658 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.6189 -13.8923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0318 -11.6429 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.5819 -12.3115 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9745 -13.0916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6803 -14.3174 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.3246 -13.4713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6803 -11.8534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0304 -13.8716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5630 -13.0916 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.9745 -13.9088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7893 -12.5096 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2688 -12.6788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3122 -12.6541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6118 -14.6021 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6312 -14.7012 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3860 -11.4448 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0428 -14.6888 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6024 -12.2620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0056 -12.2372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8461 -13.7437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9663 -11.4531 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.7361 -13.4506 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.2875 -11.0238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0015 -11.4283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5817 -11.4448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2751 -10.2066 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1950 -15.3079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3902 -14.7961 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2 4 1 0
3 1 1 0
4 1 1 0
1 5 1 1
6 18 1 0
7 2 1 0
8 6 1 0
9 6 2 0
10 5 1 0
11 9 1 0
12 8 1 0
13 19 1 0
14 4 1 0
15 10 1 0
16 7 1 0
17 15 1 0
18 21 1 0
19 14 1 0
20 3 2 0
21 13 1 0
15 22 1 1
23 1 1 0
24 10 2 0
25 16 2 0
26 17 2 0
27 22 1 0
28 22 2 0
29 8 1 0
30 16 1 0
31 17 1 0
32 33 2 0
33 28 1 0
34 27 2 0
35 32 1 0
36 23 1 0
4 37 1 6
2 3 1 0
7 13 2 0
32 34 1 0
12 11 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 520.48Molecular Weight (Monoisotopic): 520.1012AlogP: -1.13#Rotatable Bonds: 9Polar Surface Area: 206.30Molecular Species: ACIDHBA: 12HBD: 4#RO5 Violations: 2HBA (Lipinski): 15HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 2.81CX Basic pKa: ┄CX LogP: 0.17CX LogD: -6.72Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.13Np Likeness Score: -0.37
References 1. Zhang E, Bai PY, Cui DY, Chu WC, Hua YG, Liu Q, Yin HY, Zhang YJ, Qin S, Liu HM.. (2018) Synthesis and bioactivities study of new antibacterial peptide mimics: The dialkyl cationic amphiphiles., 143 [PMID:29126736 ] [10.1016/j.ejmech.2017.10.044 ] 2. Tresse C, Radigue R, Gomes Von Borowski R, Thepaut M, Hanh Le H, Demay F, Georgeault S, Dhalluin A, Trautwetter A, Ermel G, Blanco C, van de Weghe P, Jean M, Giard JC, Gillet R.. (2019) Synthesis and evaluation of 1,3,4-oxadiazole derivatives for development as broad-spectrum antibiotics., 27 (21): [PMID:31540826 ] [10.1016/j.bmc.2019.115097 ] 3. Torosyan H, Shoichet BK.. (2019) Protein Stability Effects in Aggregate-Based Enzyme Inhibition., 62 (21): [PMID:31589047 ] [10.1021/acs.jmedchem.9b01019 ] 4. Bai PY,Qin SS,Chu WC,Yang Y,Cui DY,Hua YG,Yang QQ,Zhang E. (2018) Synthesis and antibacterial bioactivities of cationic deacetyl linezolid amphiphiles., 155 [PMID:29966917 ] [10.1016/j.ejmech.2018.06.054 ]