The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
pyridin-3-ylmethyl 4-(5-methoxy-2-(pyrrolidin-1-yl)benzamido)benzylcarbamate ID: ALA5193979
PubChem CID: 156781180
Max Phase: Preclinical
Molecular Formula: C26H28N4O4
Molecular Weight: 460.53
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(N2CCCC2)c(C(=O)Nc2ccc(CNC(=O)OCc3cccnc3)cc2)c1
Standard InChI: InChI=1S/C26H28N4O4/c1-33-22-10-11-24(30-13-2-3-14-30)23(15-22)25(31)29-21-8-6-19(7-9-21)17-28-26(32)34-18-20-5-4-12-27-16-20/h4-12,15-16H,2-3,13-14,17-18H2,1H3,(H,28,32)(H,29,31)
Standard InChI Key: KTQOJTSXCUAHNH-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
-5.7133 1.1160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9987 1.5283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2868 1.1164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2868 0.2912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9969 -0.1205 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.7133 0.2875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5722 1.5290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8575 1.1164 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1429 1.5290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4283 1.1164 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.1429 2.3542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7136 1.5290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0009 1.1164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7157 1.5288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4278 1.1168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4278 0.2914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7175 -0.1205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0009 0.2877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1424 -0.1211 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8571 0.2914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5717 -0.1211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8571 1.1165 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2865 0.2912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9986 -0.1207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9986 -0.9462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2884 -1.3581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5717 -0.9499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8571 -1.3625 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.7709 -2.1827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9641 -2.3542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5517 -1.6400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1037 -1.0270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7133 0.2918 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7133 1.1170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
3 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
9 11 2 0
10 12 1 0
12 13 1 0
14 13 2 0
15 14 1 0
16 15 2 0
17 16 1 0
18 17 2 0
13 18 1 0
16 19 1 0
19 20 1 0
20 21 1 0
20 22 2 0
23 21 2 0
24 23 1 0
25 24 2 0
26 25 1 0
27 26 2 0
21 27 1 0
28 27 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 28 1 0
24 33 1 0
33 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 460.53Molecular Weight (Monoisotopic): 460.2111AlogP: 4.37#Rotatable Bonds: 8Polar Surface Area: 92.79Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.59CX Basic pKa: 4.96CX LogP: 3.49CX LogD: 3.49Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.52Np Likeness Score: -1.47
References 1. Feng Y, Lu Y, Li J, Zhang H, Li Z, Feng H, Deng X, Liu D, Shi T, Jiang W, He Y, Zhang J, Wang Z.. (2022) Design, synthesis and biological evaluation of novel o-aminobenzamide derivatives as potential anti-gastric cancer agents in vitro and in vivo., 227 [PMID:34628244 ] [10.1016/j.ejmech.2021.113888 ]