The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(6,6,6-trifluoro-4-(4-methyl-3-oxo-3,4-dihydroquinoxalin-2-yl)hexyl)-4-(trifluoromethoxy)benzamide ID: ALA5194008
PubChem CID: 168288815
Max Phase: Preclinical
Molecular Formula: C23H21F6N3O3
Molecular Weight: 501.43
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cn1c(=O)c(C(CCCNC(=O)c2ccc(OC(F)(F)F)cc2)CC(F)(F)F)nc2ccccc21
Standard InChI: InChI=1S/C23H21F6N3O3/c1-32-18-7-3-2-6-17(18)31-19(21(32)34)15(13-22(24,25)26)5-4-12-30-20(33)14-8-10-16(11-9-14)35-23(27,28)29/h2-3,6-11,15H,4-5,12-13H2,1H3,(H,30,33)
Standard InChI Key: QJBHATGQCOYNNH-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 37 0 0 0 0 0 0 0 0999 V2000
-5.0004 -1.0309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2858 -0.6186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5739 -1.0304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5739 -1.8557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2840 -2.2675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0004 -1.8594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8592 -0.6179 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.1446 -1.0305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1446 -1.8557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8592 -2.2682 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.4300 -2.2683 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.8592 -3.0935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4300 -0.6179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4300 0.2072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7153 -1.0305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0007 -0.6179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7138 -1.0305 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.7153 0.6198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7153 1.4450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0007 1.8576 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.7138 1.4450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4285 1.8576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7138 0.6198 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.4133 0.0966 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.4118 0.0966 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.4287 2.6828 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1416 3.0935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8565 2.6808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8580 1.8597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1462 1.4432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5710 3.0934 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2857 2.6808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0004 3.0934 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.8724 1.9648 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.6975 1.9648 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
3 7 1 0
8 7 2 0
9 8 1 0
10 9 1 0
4 10 1 0
9 11 2 0
10 12 1 0
8 13 1 0
13 14 1 0
13 15 1 0
15 16 1 0
16 17 1 0
14 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
21 23 2 0
16 24 1 0
16 25 1 0
26 22 2 0
27 26 1 0
28 27 2 0
29 28 1 0
30 29 2 0
22 30 1 0
28 31 1 0
31 32 1 0
32 33 1 0
32 34 1 0
32 35 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 501.43Molecular Weight (Monoisotopic): 501.1487AlogP: 5.08#Rotatable Bonds: 8Polar Surface Area: 73.22Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 1.75CX LogP: 5.42CX LogD: 5.42Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.35Np Likeness Score: -0.91
References 1. Jiang X, Wu K, Bai R, Zhang P, Zhang Y.. (2022) Functionalized quinoxalinones as privileged structures with broad-ranging pharmacological activities., 229 [PMID:34998058 ] [10.1016/j.ejmech.2021.114085 ]