3-(3-(2-methoxyphenyl)-4-oxothiazolidin-2-yl)-N-(4-(thiophen-2-yl)butyl)benzamide

ID: ALA5194124

PubChem CID: 168289681

Max Phase: Preclinical

Molecular Formula: C25H26N2O3S2

Molecular Weight: 466.63

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccccc1N1C(=O)CSC1c1cccc(C(=O)NCCCCc2cccs2)c1

Standard InChI:  InChI=1S/C25H26N2O3S2/c1-30-22-13-3-2-12-21(22)27-23(28)17-32-25(27)19-9-6-8-18(16-19)24(29)26-14-5-4-10-20-11-7-15-31-20/h2-3,6-9,11-13,15-16,25H,4-5,10,14,17H2,1H3,(H,26,29)

Standard InChI Key:  WLCORIOMUBTJSS-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   -1.3609   -2.0401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5347   -1.2336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3245   -0.9756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9400   -1.5304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7674   -2.3434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9715   -2.5974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9200   -0.6775    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1117   -0.8468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2296   -1.6066    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3035   -0.1290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2525    0.4867    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0082    0.1453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7266    0.5571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7266    1.3904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4489    1.8024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4489    2.6320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1710    3.0458    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7374    3.0478    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0188    2.6340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2995    3.0539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4190    2.6401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1340    3.0559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8568    2.6462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6113    2.9894    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.1710    2.3778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7622    1.6566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9500    1.8225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1661    1.3893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1661    0.5564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4463    0.1431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5598   -2.2547    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3451   -3.0559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  6  1  2  0
  5  6  1  0
  7  2  1  0
  7  8  1  0
  8  9  2  0
  8 10  1  0
 10 11  1  0
 11 12  1  0
 12  7  1  0
 13 12  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 16 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 24 23  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 23  2  0
 15 28  1  0
 28 29  2  0
 30 13  2  0
 29 30  1  0
  1 31  1  0
 31 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5194124

    ---

Associated Targets(Human)

HOS-TE85 (154 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 466.63Molecular Weight (Monoisotopic): 466.1385AlogP: 5.29#Rotatable Bonds: 9
Polar Surface Area: 58.64Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 4.91CX LogD: 4.91
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.44Np Likeness Score: -1.46

References

1. Deng Y, Pi R, Niu L, Zhao Y, Ni D, Song L, Li Z, Han W, Wei Q, Han Y, Zhu T, Luo Z, Sun D, Dong S, Liu S..  (2022)  Novel 2-phenyl-3-(Pyridin-2-yl) thiazolidin-4-one derivatives as potent inhibitors for proliferation of osteosarcoma cells in vitro and in vivo.,  228  [PMID:34861640] [10.1016/j.ejmech.2021.114010]

Source