1-acetyl-N-(3-(furan-3-yl)phenyl)indoline-5-sulfonamide

ID: ALA5194214

PubChem CID: 168286222

Max Phase: Preclinical

Molecular Formula: C20H18N2O4S

Molecular Weight: 382.44

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)N1CCc2cc(S(=O)(=O)Nc3cccc(-c4ccoc4)c3)ccc21

Standard InChI:  InChI=1S/C20H18N2O4S/c1-14(23)22-9-7-16-12-19(5-6-20(16)22)27(24,25)21-18-4-2-3-15(11-18)17-8-10-26-13-17/h2-6,8,10-13,21H,7,9H2,1H3

Standard InChI Key:  QHHJYQWEQZJICP-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 27 30  0  0  0  0  0  0  0  0999 V2000
   -1.6054   -0.6435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8908   -0.2312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1789   -0.6431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1789   -1.4683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8890   -1.8801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6054   -1.4720    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3932   -0.3875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3933   -1.7280    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8802   -1.0577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6077   -2.5280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0220   -3.1137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4077   -2.7424    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5383   -0.2290    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.2556   -0.6431    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.9728   -0.2290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9532    0.4895    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.1249    0.4895    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9731    0.5993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6886    1.0114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4061    0.5972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4077   -0.2268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6932   -0.6449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6886    1.8397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0189    2.3263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2747    3.1137    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1026    3.1137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3584    2.3263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  1  7  1  0
  6  8  1  0
  8  9  1  0
  9  7  1  0
  8 10  1  0
 10 11  1  0
 10 12  2  0
  3 13  1  0
 13 14  1  0
 14 15  1  0
 13 16  2  0
 13 17  2  0
 18 15  2  0
 19 18  1  0
 20 19  2  0
 21 20  1  0
 22 21  2  0
 15 22  1  0
 23 19  1  0
 23 24  2  0
 24 25  1  0
 25 26  1  0
 26 27  2  0
 27 23  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5194214

    ---

Associated Targets(Human)

TRIM24 Tchem Transcription intermediary factor 1-alpha (2087 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 382.44Molecular Weight (Monoisotopic): 382.0987AlogP: 3.66#Rotatable Bonds: 4
Polar Surface Area: 79.62Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 7.85CX Basic pKa: CX LogP: 2.39CX LogD: 2.28
Aromatic Rings: 3Heavy Atoms: 27QED Weighted: 0.75Np Likeness Score: -1.50

References

1. Xiang Q, Luo G, Zhang C, Hu Q, Wang C, Wu T, Xu H, Hu J, Zhuang X, Zhang M, Wu S, Xu J, Zhang Y, Liu J, Xu Y..  (2022)  Discovery, optimization and evaluation of 1-(indolin-1-yl)ethan-1-ones as novel selective TRIM24/BRPF1 bromodomain inhibitors.,  236  [PMID:35385803] [10.1016/j.ejmech.2022.114311]

Source