The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
12-[4-(Furan-2-carbonyl)-piperazin-1-ylmethyl]-9-hydroxy-10-methoxy-5,6-dihydro-[1,3]dioxolo[4,5-g]isoquino[3,2-a]isoquinolin-7-ylium chloride ID: ALA5194367
PubChem CID: 168287967
Max Phase: Preclinical
Molecular Formula: C29H28ClN3O6
Molecular Weight: 514.56
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(CN2CCN(C(=O)c3ccco3)CC2)c2cc3[n+](cc2c1O)CCc1cc2c(cc1-3)OCO2.[Cl-]
Standard InChI: InChI=1S/C29H27N3O6.ClH/c1-35-27-12-19(15-30-6-8-31(9-7-30)29(34)24-3-2-10-36-24)20-13-23-21-14-26-25(37-17-38-26)11-18(21)4-5-32(23)16-22(20)28(27)33;/h2-3,10-14,16H,4-9,15,17H2,1H3;1H
Standard InChI Key: RTQGUUMMBRYBJO-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 44 0 0 0 0 0 0 0 0999 V2000
1.3355 3.7197 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-3.2815 3.8830 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.6611 3.1505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0818 2.5633 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.3442 2.9327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4676 3.7484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8255 4.2608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0631 3.9614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4227 4.4722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3424 4.1725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4666 3.3644 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2305 3.0701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3587 2.2587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1194 1.9672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2486 1.1604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6186 0.6464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8542 0.9334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7245 1.7436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0430 2.0336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1717 2.8481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9402 3.1489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5779 2.6376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2095 0.4187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3331 -0.3966 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.1010 -0.6974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2244 -1.5129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5801 -2.0275 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.1877 -1.7268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3112 -0.9113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7035 -2.8432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0166 0.8596 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6611 1.3742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7639 2.4821 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0587 -3.3578 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4715 -3.1440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6430 -3.9509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4633 -4.0372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7989 -3.2836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1859 -2.7317 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3 2 1 0
4 3 1 0
5 4 1 0
6 5 1 0
6 2 1 0
7 6 2 0
8 7 1 0
8 9 1 0
10 9 1 0
11 10 1 0
11 12 1 0
13 12 2 0
13 14 1 0
15 14 2 0
16 15 1 0
17 16 2 0
18 17 1 0
18 13 1 0
19 18 2 0
20 19 1 0
20 11 2 0
21 20 1 0
21 8 2 0
22 21 1 0
5 22 2 0
17 23 1 0
23 24 1 0
25 24 1 0
26 25 1 0
27 26 1 0
28 27 1 0
29 28 1 0
24 29 1 0
30 27 1 0
15 31 1 0
31 32 1 0
14 33 1 0
30 35 1 0
30 34 2 0
36 37 1 0
37 38 2 0
35 36 2 0
38 39 1 0
35 39 1 0
M CHG 2 1 -1 11 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 514.56Molecular Weight (Monoisotopic): 514.1973AlogP: 3.34#Rotatable Bonds: 4Polar Surface Area: 88.49Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.23CX Basic pKa: 6.17CX LogP: -1.50CX LogD: -1.58Aromatic Rings: 4Heavy Atoms: 38QED Weighted: 0.42Np Likeness Score: 0.10
References 1. Gaba S, Saini A, Singh G, Monga V.. (2021) An insight into the medicinal attributes of berberine derivatives: A review., 38 [PMID:33848698 ] [10.1016/j.bmc.2021.116143 ]