3-(3-(4-cyclopropylphenyl)-4-oxothiazolidin-2-yl)-N-(4-phenylbutyl)benzamide

ID: ALA5194610

PubChem CID: 168289705

Max Phase: Preclinical

Molecular Formula: C29H30N2O2S

Molecular Weight: 470.64

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(NCCCCc1ccccc1)c1cccc(C2SCC(=O)N2c2ccc(C3CC3)cc2)c1

Standard InChI:  InChI=1S/C29H30N2O2S/c32-27-20-34-29(31(27)26-16-14-23(15-17-26)22-12-13-22)25-11-6-10-24(19-25)28(33)30-18-5-4-9-21-7-2-1-3-8-21/h1-3,6-8,10-11,14-17,19,22,29H,4-5,9,12-13,18,20H2,(H,30,33)

Standard InChI Key:  OTPAZRQSTJPHSE-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
   -0.9285   -1.7079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1023   -0.9014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8922   -0.6434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5076   -1.1982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3350   -2.0113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5392   -2.2652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9215   -2.5977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1371   -3.3987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7242   -2.8128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4876   -0.3453    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3206   -0.5146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6621   -1.2744    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7359    0.2031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1798    0.8190    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5758    0.4775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2942    0.8893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2942    1.7226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0165    2.1347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0165    2.9643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7387    3.3781    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3050    3.3801    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5864    2.9662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1328    3.3862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8514    2.9724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5664    3.3881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2892    2.9785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0027    3.3987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7242    2.9903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7242    2.1546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0076    1.7388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2892    2.1524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7338    1.7216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7338    0.8886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0140    0.4753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  1  2  0
  7  5  1  0
  7  8  1  0
  9  8  1  0
  7  9  1  0
 10  2  1  0
 10 11  1  0
 11 12  2  0
 11 13  1  0
 13 14  1  0
 14 15  1  0
 15 10  1  0
 16 15  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 19 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 27 26  1  0
 28 27  2  0
 29 28  1  0
 30 29  2  0
 31 30  1  0
 26 31  2  0
 18 32  1  0
 32 33  2  0
 33 34  1  0
 34 16  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5194610

    ---

Associated Targets(Human)

HOS-TE85 (154 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 470.64Molecular Weight (Monoisotopic): 470.2028AlogP: 6.10#Rotatable Bonds: 9
Polar Surface Area: 49.41Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 5.94CX LogD: 5.94
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.38Np Likeness Score: -0.89

References

1. Deng Y, Pi R, Niu L, Zhao Y, Ni D, Song L, Li Z, Han W, Wei Q, Han Y, Zhu T, Luo Z, Sun D, Dong S, Liu S..  (2022)  Novel 2-phenyl-3-(Pyridin-2-yl) thiazolidin-4-one derivatives as potent inhibitors for proliferation of osteosarcoma cells in vitro and in vivo.,  228  [PMID:34861640] [10.1016/j.ejmech.2021.114010]

Source