2-(1H-indol-4-yl)-6-(1-methyl-1H-pyrazol-5-yl)-4-(4-(methylsulfonyl)piperazin-1-yl)quinazoline

ID: ALA5194672

PubChem CID: 168287109

Max Phase: Preclinical

Molecular Formula: C25H25N7O2S

Molecular Weight: 487.59

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cn1nccc1-c1ccc2nc(-c3cccc4[nH]ccc34)nc(N3CCN(S(C)(=O)=O)CC3)c2c1

Standard InChI:  InChI=1S/C25H25N7O2S/c1-30-23(9-11-27-30)17-6-7-22-20(16-17)25(31-12-14-32(15-13-31)35(2,33)34)29-24(28-22)19-4-3-5-21-18(19)8-10-26-21/h3-11,16,26H,12-15H2,1-2H3

Standard InChI Key:  WNRKOKLVNNNTGY-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 40  0  0  0  0  0  0  0  0999 V2000
    2.4897    1.8008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6612    0.9938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4816    0.9076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8172    1.6612    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2041    2.2133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2041    3.0382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4897    3.4508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7752    3.0382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7752    2.2133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0607    1.8008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0607    0.9758    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3463    0.5633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3463   -0.2616    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0607   -0.6741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0607   -1.4991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3463   -1.9116    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3463   -2.7366    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.0607   -3.1491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3681   -1.4991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3681   -0.6741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3681    0.9758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0826    0.5633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7970    0.9758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5115    0.5633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5977   -0.2571    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9846   -0.8091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4047   -0.4286    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8172    0.2858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2652    0.8988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7970    1.8008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0826    2.2133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3681    1.8008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3463    2.2133    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4804   -2.7366    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0671   -3.4508    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  2  0
  4  3  1  0
  5  4  1  0
  1  5  2  0
  5  6  1  0
  7  6  2  0
  8  7  1  0
  1  9  1  0
  9  8  2  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 13 12  1  0
 13 14  1  0
 15 14  1  0
 16 15  1  0
 17 16  1  0
 18 17  1  0
 19 16  1  0
 20 19  1  0
 13 20  1  0
 21 12  1  0
 21 22  1  0
 22 23  2  0
 24 23  1  0
 25 24  1  0
 26 25  1  0
 25 27  1  0
 27 28  2  0
 28 29  1  0
 29 24  2  0
 23 30  1  0
 30 31  2  0
 32 31  1  0
 21 32  2  0
 32 33  1  0
 33 10  2  0
 17 34  2  0
 17 35  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5194672

    ---

Associated Targets(Human)

ATR Tchem Serine-protein kinase ATR (986 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 487.59Molecular Weight (Monoisotopic): 487.1790AlogP: 3.26#Rotatable Bonds: 4
Polar Surface Area: 100.01Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 4.58CX LogP: 3.38CX LogD: 3.38
Aromatic Rings: 5Heavy Atoms: 35QED Weighted: 0.42Np Likeness Score: -1.61

References

1. Bin H, Chen P, Wu M, Wang F, Lin G, Pan S, Liu J, Mu B, Nan J, Huang Q, Li L, Yang S..  (2022)  Discovery of a potent and highly selective inhibitor of ataxia telangiectasia mutated and Rad3-Related (ATR) kinase: Structural activity relationship and antitumor activity both in vitro and in vivo.,  232  [PMID:35183872] [10.1016/j.ejmech.2022.114187]

Source