The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-1-(3-(4-((1-(4-Acetylphenyl)-3,3,3-trifluoroprop-1-en-1-yl)sulfonyl)phenoxy)propyl)-4-methylpiperazin-1-ium chloride ID: ALA5194877
PubChem CID: 168284300
Max Phase: Preclinical
Molecular Formula: C24H28ClF3N2O4S
Molecular Weight: 496.55
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)c1ccc(/C(=C\C(F)(F)F)S(=O)(=O)c2ccc(OCCN3CCN(C)CC3)cc2)cc1.Cl
Standard InChI: InChI=1S/C24H27F3N2O4S.ClH/c1-18(30)19-3-5-20(6-4-19)23(17-24(25,26)27)34(31,32)22-9-7-21(8-10-22)33-16-15-29-13-11-28(2)12-14-29;/h3-10,17H,11-16H2,1-2H3;1H/b23-17+;
Standard InChI Key: ZTSYUERKJYBUHV-YFZNFVDXSA-N
Molfile:
RDKit 2D
35 36 0 0 0 0 0 0 0 0999 V2000
4.2842 0.2065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5697 -0.2059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5697 -1.0308 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.2842 -1.4433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9986 -1.0308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9986 -0.2059 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.7131 0.2065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8553 -1.4433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1408 -1.0308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4262 -1.4433 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7119 -1.0308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7119 -0.2056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7146 -0.2060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7146 -1.0345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0017 -1.4427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4291 0.2064 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-1.8407 0.9222 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0158 0.9222 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1435 -0.2060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1435 -1.0310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8580 -1.4435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5725 -1.8560 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.5725 -1.0310 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.8580 -2.2684 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.8580 0.2064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5679 -0.2052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2840 0.2027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2840 1.0310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9986 1.4435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9986 2.2684 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.7131 1.0310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5697 1.4432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8580 1.0314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3219 -2.0297 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
4 5 1 0
5 6 1 0
6 1 1 0
6 7 1 0
9 8 1 0
10 9 1 0
11 10 1 0
12 11 2 0
12 13 1 0
13 14 2 0
14 15 1 0
16 15 2 0
11 16 1 0
17 14 1 0
17 18 2 0
17 19 2 0
17 20 1 0
20 21 2 0
21 22 1 0
22 23 1 0
22 24 1 0
22 25 1 0
26 20 1 0
26 27 1 0
27 28 2 0
29 28 1 0
29 30 1 0
30 31 2 0
30 32 1 0
33 29 2 0
33 34 1 0
34 26 2 0
2 3 1 0
3 4 1 0
8 3 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 496.55Molecular Weight (Monoisotopic): 496.1644AlogP: 3.89#Rotatable Bonds: 8Polar Surface Area: 66.92Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.66CX LogP: 3.23CX LogD: 2.78Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.52Np Likeness Score: -0.94
References 1. Zhang J, Wang X, Chen Q, Liu J, Zhou W, Wu J.. (2022) (E)-β-Trifluoromethyl vinylsulfones as antitumor agents: Synthesis and biological evaluations., 232 [PMID:35189568 ] [10.1016/j.ejmech.2022.114197 ]