The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-(2-Amino-6-(benzyloxy)-9H-purin-9-yl)butyl)phthalimide ID: ALA5195028
PubChem CID: 168285852
Max Phase: Preclinical
Molecular Formula: C24H22N6O3
Molecular Weight: 442.48
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Nc1nc(OCc2ccccc2)c2ncn(CCCCN3C(=O)c4ccccc4C3=O)c2n1
Standard InChI: InChI=1S/C24H22N6O3/c25-24-27-20-19(21(28-24)33-14-16-8-2-1-3-9-16)26-15-29(20)12-6-7-13-30-22(31)17-10-4-5-11-18(17)23(30)32/h1-5,8-11,15H,6-7,12-14H2,(H2,25,27,28)
Standard InChI Key: WMJNJQJDGIXMGV-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
1.4300 -3.2587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6050 -3.2587 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9250 -3.9462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7225 -3.6712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7225 -2.8462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3825 -2.3787 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9250 -2.5987 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.6775 -1.8287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8525 -1.6362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6050 -0.8662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1925 -0.7012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4400 0.0962 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0275 0.7562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4400 1.4162 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2375 1.1687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9524 1.5812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6675 1.1687 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6675 0.3437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9524 -0.0687 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2375 0.3437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3825 -0.0687 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.9524 2.4062 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.6675 2.8187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6675 3.6437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3825 4.0562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3825 4.8812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6675 5.2937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9524 4.8812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9524 4.0562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3275 -4.2487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1625 -5.0462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3649 -5.2937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7600 -4.7437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
1 3 1 0
3 4 1 0
4 5 1 0
5 6 2 0
1 7 1 0
5 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
13 12 1 0
14 13 2 0
14 15 1 0
16 15 2 0
17 16 1 0
18 17 2 0
19 18 1 0
12 20 1 0
20 19 2 0
20 15 1 0
18 21 1 0
16 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
24 29 2 0
4 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
3 33 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 442.48Molecular Weight (Monoisotopic): 442.1753AlogP: 3.06#Rotatable Bonds: 8Polar Surface Area: 116.23Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 4.25CX LogP: 3.26CX LogD: 3.26Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.33Np Likeness Score: -0.95
References 1. Franco Pinto J, Fillion A, Duchambon P, Bombard S, Granzhan A.. (2022) Acridine-O6 -benzylguanine hybrids: Synthesis, DNA binding, MGMT inhibition and antiproliferative activity., 227 [PMID:34731767 ] [10.1016/j.ejmech.2021.113909 ]