The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Butyl ((4-(4-((2-cyclopropyl-1H-imidazol-1-yl)methyl)phenyl)-2-isobutylthiazol-5-yl)sulfonyl)carbamate ID: ALA5195051
PubChem CID: 166492458
Max Phase: Preclinical
Molecular Formula: C25H32N4O4S2
Molecular Weight: 516.69
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCOC(=O)NS(=O)(=O)c1sc(CC(C)C)nc1-c1ccc(Cn2ccnc2C2CC2)cc1
Standard InChI: InChI=1S/C25H32N4O4S2/c1-4-5-14-33-25(30)28-35(31,32)24-22(27-21(34-24)15-17(2)3)19-8-6-18(7-9-19)16-29-13-12-26-23(29)20-10-11-20/h6-9,12-13,17,20H,4-5,10-11,14-16H2,1-3H3,(H,28,30)
Standard InChI Key: YWYMVVYXLDZWNY-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
-1.8081 3.2597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0022 3.4360 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.5855 2.7239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1341 2.1076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8897 2.4389 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6018 2.0222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5971 1.1972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8802 0.7888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8754 -0.0362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5876 -0.4527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5828 -1.2778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9126 -1.7589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1154 -1.5452 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-0.5319 -2.1288 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.2652 -1.9152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8488 -2.4989 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.6459 -2.2852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4788 -1.1181 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3290 -0.7481 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.5306 -0.9606 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1630 -2.5450 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-2.9880 -2.5498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2475 -1.7666 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.4691 -3.2200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1292 -3.9718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3081 -4.0533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6103 -4.6420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3044 -0.0443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3092 0.7806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2296 -2.8687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0267 -2.6551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6103 -3.2386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3917 3.8434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6057 4.6420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1887 4.0579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
1 5 1 0
4 5 1 0
6 5 1 0
7 6 1 0
8 7 1 0
9 8 2 0
10 9 1 0
11 10 1 0
11 12 2 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
15 18 2 0
13 19 2 0
13 20 2 0
12 21 1 0
21 22 1 0
23 11 1 0
22 23 2 0
22 24 1 0
24 25 1 0
25 26 1 0
25 27 1 0
28 10 2 0
7 29 2 0
29 28 1 0
17 30 1 0
30 31 1 0
31 32 1 0
33 1 1 0
33 34 1 0
33 35 1 0
34 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 516.69Molecular Weight (Monoisotopic): 516.1865AlogP: 5.35#Rotatable Bonds: 11Polar Surface Area: 103.18Molecular Species: ACIDHBA: 8HBD: 1#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 4.56CX Basic pKa: 6.74CX LogP: 4.17CX LogD: 4.64Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.34Np Likeness Score: -0.97
References 1. Gopalan G, Palo-Nieto C, Petersen NN, Hallberg M, Larhed M.. (2022) Angiotensin II AT2 receptor ligands with phenylthiazole scaffolds., 65 [PMID:35550979 ] [10.1016/j.bmc.2022.116790 ]