Butyl ((4-(4-((2-cyclopropyl-1H-imidazol-1-yl)methyl)phenyl)-2-isobutylthiazol-5-yl)sulfonyl)carbamate

ID: ALA5195051

PubChem CID: 166492458

Max Phase: Preclinical

Molecular Formula: C25H32N4O4S2

Molecular Weight: 516.69

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCOC(=O)NS(=O)(=O)c1sc(CC(C)C)nc1-c1ccc(Cn2ccnc2C2CC2)cc1

Standard InChI:  InChI=1S/C25H32N4O4S2/c1-4-5-14-33-25(30)28-35(31,32)24-22(27-21(34-24)15-17(2)3)19-8-6-18(7-9-19)16-29-13-12-26-23(29)20-10-11-20/h6-9,12-13,17,20H,4-5,10-11,14-16H2,1-3H3,(H,28,30)

Standard InChI Key:  YWYMVVYXLDZWNY-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   -1.8081    3.2597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0022    3.4360    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5855    2.7239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1341    2.1076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8897    2.4389    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6018    2.0222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5971    1.1972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8802    0.7888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8754   -0.0362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5876   -0.4527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5828   -1.2778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9126   -1.7589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1154   -1.5452    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5319   -2.1288    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.2652   -1.9152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8488   -2.4989    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.6459   -2.2852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4788   -1.1181    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3290   -0.7481    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5306   -0.9606    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1630   -2.5450    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9880   -2.5498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2475   -1.7666    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4691   -3.2200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1292   -3.9718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3081   -4.0533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6103   -4.6420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3044   -0.0443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3092    0.7806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2296   -2.8687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0267   -2.6551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6103   -3.2386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3917    3.8434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6057    4.6420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1887    4.0579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  1  5  1  0
  4  5  1  0
  6  5  1  0
  7  6  1  0
  8  7  1  0
  9  8  2  0
 10  9  1  0
 11 10  1  0
 11 12  2  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 15 18  2  0
 13 19  2  0
 13 20  2  0
 12 21  1  0
 21 22  1  0
 23 11  1  0
 22 23  2  0
 22 24  1  0
 24 25  1  0
 25 26  1  0
 25 27  1  0
 28 10  2  0
  7 29  2  0
 29 28  1  0
 17 30  1  0
 30 31  1  0
 31 32  1  0
 33  1  1  0
 33 34  1  0
 33 35  1  0
 34 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5195051

    ---

Associated Targets(Human)

AGTR2 Tchem Angiotensin II type 2 (AT-2) receptor (2549 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
AGTR1 Tclin Type-1 angiotensin II receptor (5176 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 516.69Molecular Weight (Monoisotopic): 516.1865AlogP: 5.35#Rotatable Bonds: 11
Polar Surface Area: 103.18Molecular Species: ACIDHBA: 8HBD: 1
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 4.56CX Basic pKa: 6.74CX LogP: 4.17CX LogD: 4.64
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.34Np Likeness Score: -0.97

References

1. Gopalan G, Palo-Nieto C, Petersen NN, Hallberg M, Larhed M..  (2022)  Angiotensin II AT2 receptor ligands with phenylthiazole scaffolds.,  65  [PMID:35550979] [10.1016/j.bmc.2022.116790]

Source