The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(2,6-Dioxopiperidin-3-yl)-4-((2-(2-(2-methoxyethoxy)ethoxy)ethyl)amino)isoindoline-1,3-dione ID: ALA5195174
PubChem CID: 139441794
Max Phase: Preclinical
Molecular Formula: C20H25N3O7
Molecular Weight: 419.43
Associated Items:
Names and Identifiers Canonical SMILES: COCCOCCOCCNc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O
Standard InChI: InChI=1S/C20H25N3O7/c1-28-9-10-30-12-11-29-8-7-21-14-4-2-3-13-17(14)20(27)23(19(13)26)15-5-6-16(24)22-18(15)25/h2-4,15,21H,5-12H2,1H3,(H,22,24,25)
Standard InChI Key: RPYMUKUTWBEVRQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
4.4356 -3.1950 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6106 -3.1950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1949 -2.4811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3699 -2.4811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9564 -3.1950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3722 -3.9125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2014 -3.9125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.9586 -4.6264 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.1314 -3.1950 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.6430 -3.8673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1471 -3.6104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1471 -2.7796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6430 -2.5230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8979 -1.7384 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.8632 -2.3605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5793 -2.7796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5793 -3.6094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8632 -4.0201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8632 -1.5355 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.5777 -1.1231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5777 -0.2981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2922 0.1144 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.2922 0.9394 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0066 1.3518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0066 2.1768 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.7210 2.5894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7210 3.4144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4356 3.8269 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.4356 4.6519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8978 -4.6519 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
3 2 1 0
4 3 1 0
5 4 1 0
6 5 1 0
7 6 1 0
7 2 1 0
8 6 2 0
5 9 1 0
10 9 1 0
11 10 1 0
12 11 2 0
9 13 1 0
12 13 1 0
13 14 2 0
12 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
11 18 1 0
19 15 1 0
20 19 1 0
20 21 1 0
22 21 1 0
23 22 1 0
23 24 1 0
25 24 1 0
26 25 1 0
26 27 1 0
28 27 1 0
29 28 1 0
10 30 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 419.43Molecular Weight (Monoisotopic): 419.1693AlogP: 0.18#Rotatable Bonds: 11Polar Surface Area: 123.27Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.59CX Basic pKa: 1.29CX LogP: 0.00CX LogD: 0.00Aromatic Rings: 1Heavy Atoms: 30QED Weighted: 0.38Np Likeness Score: -0.70
References 1. Zhu CL, Luo X, Tian T, Rao Z, Wang H, Zhou Z, Mi T, Chen D, Xu Y, Wu Y, Che J, Zhou Y, Li J, Dong X.. (2022) Structure-based rational design enables efficient discovery of a new selective and potent AKT PROTAC degrader., 238 [PMID:35635954 ] [10.1016/j.ejmech.2022.114459 ]