The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(6-(4-methoxyphenyl)imidazo[2,1-b]thiazol-5-yl)-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one ID: ALA5195207
PubChem CID: 51353293
Max Phase: Preclinical
Molecular Formula: C24H22N2O5S
Molecular Weight: 450.52
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-c2nc3sccn3c2/C=C/C(=O)c2cc(OC)c(OC)c(OC)c2)cc1
Standard InChI: InChI=1S/C24H22N2O5S/c1-28-17-7-5-15(6-8-17)22-18(26-11-12-32-24(26)25-22)9-10-19(27)16-13-20(29-2)23(31-4)21(14-16)30-3/h5-14H,1-4H3/b10-9+
Standard InChI Key: XFQIHTLSGRJKNZ-MDZDMXLPSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
1.5997 -0.7889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4247 -0.7889 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6748 -1.5929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0212 -2.0636 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.3538 -1.5716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1324 -0.3013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7893 -0.7955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5122 -1.5952 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
0.5527 -1.7863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1849 -0.0706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3555 -0.0706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0590 0.6476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8885 0.6476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3555 1.3659 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3035 -0.0705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1304 -0.0697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5452 0.6486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1339 1.3642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3050 1.3690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3377 -2.5875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4611 -2.8008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0478 -2.2141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8357 -1.4165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0363 -1.1974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8489 -2.4288 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.4354 -1.8423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5451 -0.7881 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.3745 -0.7881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3746 0.6486 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.7893 1.3670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5486 2.0825 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1339 2.8008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
1 5 2 0
5 4 1 0
2 6 1 0
6 7 2 0
8 7 1 0
3 8 1 0
5 9 1 0
1 10 1 0
10 11 2 0
11 12 1 0
12 13 1 0
12 14 2 0
15 13 2 0
16 15 1 0
17 16 2 0
18 17 1 0
19 18 2 0
13 19 1 0
20 9 2 0
21 20 1 0
22 21 2 0
23 22 1 0
24 23 2 0
9 24 1 0
22 25 1 0
25 26 1 0
16 27 1 0
27 28 1 0
17 29 1 0
29 30 1 0
18 31 1 0
31 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 450.52Molecular Weight (Monoisotopic): 450.1249AlogP: 4.99#Rotatable Bonds: 8Polar Surface Area: 71.29Molecular Species: NEUTRALHBA: 8HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 3.40CX LogP: 4.03CX LogD: 4.03Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.28Np Likeness Score: -0.95
References 1. Sbenati RM, Semreen MH, Semreen AM, Shehata MK, Alsaghir FM, El-Gamal MI.. (2021) Evaluation of imidazo[2,1-b]thiazole-based anticancer agents in one decade (2011-2020): Current status and future prospects., 29 [PMID:33316752 ] [10.1016/j.bmc.2020.115897 ]