2-{[4-(1-{spiro[adamantane-2,2'-[1,3,4]trioxan]-5'-yl}ethenyl)naphthalen-1-yl]oxy}ethan-1-ol

ID: ALA5195209

PubChem CID: 168288012

Max Phase: Preclinical

Molecular Formula: C26H30O5

Molecular Weight: 422.52

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=C(c1ccc(OCCO)c2ccccc12)C1COC2(OO1)C1CC3CC(C1)CC2C3

Standard InChI:  InChI=1S/C26H30O5/c1-16(21-6-7-24(28-9-8-27)23-5-3-2-4-22(21)23)25-15-29-26(31-30-25)19-11-17-10-18(13-19)14-20(26)12-17/h2-7,17-20,25,27H,1,8-15H2

Standard InChI Key:  IHKUHLIPTAEBEF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 36  0  0  0  0  0  0  0  0999 V2000
   42.0381   -6.7094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.6714   -6.0343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.8326   -6.4872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.3739   -6.2895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.5759   -6.7820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.1124   -6.1063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.8299   -5.6452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.3796   -4.9956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.6670   -5.2446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.1182   -5.2976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7361   -3.1827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7350   -3.9998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1455   -3.1791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4390   -2.7751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1484   -3.9993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4374   -4.4046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.4330   -5.2185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1377   -5.6333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.8488   -5.2279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.8549   -4.4079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.7246   -5.6210    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.0218   -5.2089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.3135   -5.6113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.6107   -5.1992    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.5621   -4.0034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.2661   -4.4136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.5655   -3.1886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.2583   -5.2332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.9582   -5.6433    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   42.6732   -4.4266    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   41.9688   -4.0120    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  1  0
  2  4  1  0
  3  5  1  0
  4  6  1  0
  5  6  1  0
  7  8  1  0
  3  7  1  0
  2  9  1  0
  6 10  1  0
 10  8  1  0
  8  9  1  0
 11 12  2  0
 12 16  1  0
 15 13  1  0
 13 14  2  0
 14 11  1  0
 15 16  2  0
 15 20  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 17 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 20 25  1  0
 25 26  1  0
 25 27  2  0
 26 28  1  0
 26 31  1  0
 28 29  1  0
 29  9  1  0
  9 30  1  0
 30 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5195209

    ---

Associated Targets(non-human)

Plasmodium yoelii nigeriensis (1119 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 422.52Molecular Weight (Monoisotopic): 422.2093AlogP: 4.72#Rotatable Bonds: 5
Polar Surface Area: 57.15Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 4.99CX LogD: 4.99
Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.71Np Likeness Score: 0.82

References

1. Karnatak M, Hassam M, Vanangamudi M, Sharma S, Kumar Yadav D, Singh C, Puri SK, Rawat V, Prakash Verma V..  (2021)  Novel naphthyl based 1,2,4-trioxanes: Synthesis and in vivo efficacy in the Plasmodium yoelii nigeriensis in Swiss mice.,  51  [PMID:34547418] [10.1016/j.bmcl.2021.128372]

Source