(3R)-1-(3-Oxo-1-(4-(trifluoromethyl)benzyl)-1,3-dihydroisobenzofuran-5-yl)pyrrolidine-3-carboxylic acid

ID: ALA5195248

PubChem CID: 168285076

Max Phase: Preclinical

Molecular Formula: C21H18F3NO4

Molecular Weight: 405.37

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C1OC(Cc2ccc(C(F)(F)F)cc2)c2ccc(N3CC[C@@H](C(=O)O)C3)cc21

Standard InChI:  InChI=1S/C21H18F3NO4/c22-21(23,24)14-3-1-12(2-4-14)9-18-16-6-5-15(10-17(16)20(28)29-18)25-8-7-13(11-25)19(26)27/h1-6,10,13,18H,7-9,11H2,(H,26,27)/t13-,18?/m1/s1

Standard InChI Key:  WYDHKYQTNYLZAN-YJJYDOSJSA-N

Molfile:  

 
     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
   -1.5889   -0.1403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8745    0.2721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1599   -0.1403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1599   -0.9653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6246   -1.2203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1095   -0.5528    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6246    0.1145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8796    0.8992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6866    1.0707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9415    1.8553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7485    2.0269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3006    1.4138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1076    1.5853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3624    2.3699    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    4.6596    0.9722    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    4.9146    1.7568    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.0456    0.6291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2386    0.4576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8796   -2.0049    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8745   -1.3779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5889   -0.9653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3034   -1.3779    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3896   -2.1984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1966   -2.3699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6092   -1.6554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4296   -1.5691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9146   -2.2366    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7652   -0.8154    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0571   -1.0423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  4  5  1  0
  6  5  1  0
  3  7  1  0
  7  6  1  0
  7  8  1  0
  8  9  1  0
 10  9  2  0
 11 10  1  0
 12 11  2  0
 12 13  1  0
 13 14  1  0
 13 15  1  0
 13 16  1  0
 17 12  1  0
 18 17  2  0
  9 18  1  0
  5 19  2  0
 20  4  1  0
 21 20  2  0
  1 21  1  0
 22 21  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  1
 26 27  1  0
 26 28  2  0
 25 29  1  0
 29 22  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5195248

    ---

Associated Targets(non-human)

Maob Monoamine oxidase B (2209 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 405.37Molecular Weight (Monoisotopic): 405.1188AlogP: 4.07#Rotatable Bonds: 4
Polar Surface Area: 66.84Molecular Species: ACIDHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 3.83CX Basic pKa: 2.34CX LogP: 4.14CX LogD: 1.08
Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.78Np Likeness Score: -0.38

References

1. Liu K, Zhou S, Zhou J, Bo R, Wang X, Xu T, Yuan Y, Xu B..  (2022)  Discovery of 3, 6-disubstituted isobenzofuran-1(3H)-ones as novel inhibitors of monoamine oxidases.,  67  [PMID:35472505] [10.1016/j.bmcl.2022.128748]

Source