(S)-N-(1-amino-3-(1,4-dioxo-1,2,3,4-tetrahydrophthalazin-6-yl)-1,3-dioxopropan-2-yl)-3-methylbenzamide

ID: ALA5195249

PubChem CID: 168285077

Max Phase: Preclinical

Molecular Formula: C19H16N4O5

Molecular Weight: 380.36

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cccc(C(=O)N[C@H](C(N)=O)C(=O)c2ccc3c(=O)[nH][nH]c(=O)c3c2)c1

Standard InChI:  InChI=1S/C19H16N4O5/c1-9-3-2-4-11(7-9)17(26)21-14(16(20)25)15(24)10-5-6-12-13(8-10)19(28)23-22-18(12)27/h2-8,14H,1H3,(H2,20,25)(H,21,26)(H,22,27)(H,23,28)/t14-/m0/s1

Standard InChI Key:  LHWBWMHNRNWQRA-AWEZNQCLSA-N

Molfile:  

 
     RDKit          2D

 28 30  0  0  0  0  0  0  0  0999 V2000
   -3.2138    0.2061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9284   -0.2061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5019   -0.2057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5019   -1.0309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2120   -1.4427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9284   -1.0346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2120   -2.2677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7873    0.2068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7873    1.0320    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0726   -0.2057    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3580    0.2068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3565   -0.2057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3580    1.0320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0726    1.4446    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3565    1.4446    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0712    0.2068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3565   -1.0309    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7889   -0.2075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5007    0.2089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4991    1.0300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0713    1.0321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7843    1.4427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2138    1.4426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2138    2.2677    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9284    1.0300    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9284    0.2048    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2153   -0.2034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2153   -1.0288    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  1  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  2  6  1  0
  5  7  1  0
  3  8  1  0
  8  9  2  0
  8 10  1  0
 10 11  1  0
 11 12  1  6
 11 13  1  0
 13 14  2  0
 13 15  1  0
 12 16  1  0
 12 17  2  0
 16 18  1  0
 19 18  2  0
 20 19  1  0
 21 16  2  0
 22 21  1  0
 22 20  2  0
 20 23  1  0
 23 24  2  0
 23 25  1  0
 25 26  1  0
 19 27  1  0
 27 26  1  0
 27 28  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5195249

    ---

Associated Targets(Human)

PARP15 Tchem Poly [ADP-ribose] polymerase 15 (178 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 380.36Molecular Weight (Monoisotopic): 380.1121AlogP: -0.01#Rotatable Bonds: 5
Polar Surface Area: 154.98Molecular Species: NEUTRALHBA: 5HBD: 4
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: 7.75CX Basic pKa: CX LogP: 0.12CX LogD: -0.02
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.36Np Likeness Score: -0.77

References

1. Nizi MG, Maksimainen MM, Murthy S, Massari S, Alaviuhkola J, Lippok BE, Sowa ST, Galera-Prat A, Prunskaite-Hyyryläinen R, Lüscher B, Korn P, Lehtiö L, Tabarrini O..  (2022)  Potent 2,3-dihydrophthalazine-1,4-dione derivatives as dual inhibitors for mono-ADP-ribosyltransferases PARP10 and PARP15.,  237  [PMID:35500474] [10.1016/j.ejmech.2022.114362]

Source