6-(5-Fluoro-2-((5-((4-isopropylpiperazin-1-yl)methyl)pyridin-2-yl)amino)pyrimidin-4-yl)-2-isopropyl-3,4-dihydroisoquinolin-1(2H)-one

ID: ALA5195468

PubChem CID: 168288432

Max Phase: Preclinical

Molecular Formula: C29H36FN7O

Molecular Weight: 517.65

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)N1CCN(Cc2ccc(Nc3ncc(F)c(-c4ccc5c(c4)CCN(C(C)C)C5=O)n3)nc2)CC1

Standard InChI:  InChI=1S/C29H36FN7O/c1-19(2)36-13-11-35(12-14-36)18-21-5-8-26(31-16-21)33-29-32-17-25(30)27(34-29)23-6-7-24-22(15-23)9-10-37(20(3)4)28(24)38/h5-8,15-17,19-20H,9-14,18H2,1-4H3,(H,31,32,33,34)

Standard InChI Key:  LPGAZCZIRANIGC-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
   -2.4884    0.6117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4884    1.4367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7768    1.8472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0680    1.4371    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0680    0.6153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7750    0.2053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3563    0.2044    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3552    0.6153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3552    1.4371    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0652    1.8460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7787    1.4351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4887    1.8460    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.7787    0.6173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0698    0.2027    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4903    0.2066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2020    0.6173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9112    0.2070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6230    0.6180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3348    0.2070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3348   -0.6149    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6230   -1.0258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9112   -0.6148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2038   -1.0250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4903   -0.6185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6230   -1.8475    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1999    1.8475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9116    1.4367    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9116    0.6150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6232    0.2042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3348    0.6150    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3348    1.4367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6232    1.8475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0464    0.2042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7580    0.6150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0464   -0.6173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0464   -1.0257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7580   -0.6149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0464   -1.8474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  2  0
  4  3  1  0
  5  4  2  0
  1  6  2  0
  6  5  1  0
  5  7  1  0
  7  8  1  0
  9  8  2  0
 10  9  1  0
 11 10  2  0
 11 12  1  0
 13 11  1  0
  8 14  1  0
 14 13  2  0
 13 15  1  0
 16 15  2  0
 17 16  1  0
 17 18  1  0
 19 18  1  0
 20 19  1  0
 21 20  1  0
 22 17  2  0
 22 21  1  0
 23 22  1  0
 15 24  1  0
 24 23  2  0
 21 25  2  0
  2 26  1  0
 26 27  1  0
 28 27  1  0
 29 28  1  0
 30 29  1  0
 31 30  1  0
 27 32  1  0
 32 31  1  0
 30 33  1  0
 33 34  1  0
 33 35  1  0
 20 36  1  0
 36 37  1  0
 36 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5195468

    ---

Associated Targets(Human)

CCND1 Tchem CDK6/cyclin D1 (322 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 517.65Molecular Weight (Monoisotopic): 517.2965AlogP: 4.35#Rotatable Bonds: 7
Polar Surface Area: 77.49Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.28CX Basic pKa: 8.21CX LogP: 4.39CX LogD: 3.52
Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.50Np Likeness Score: -1.27

References

1. Chen W, Ji M, Cheng H, Zheng M, Xia F, Min W, Yang H, Wang X, Wang L, Cao L, Yuan K, Yang P..  (2022)  Discovery, Optimization, and Evaluation of Selective CDK4/6 Inhibitors for the Treatment of Breast Cancer.,  65  (22.0): [PMID:36350721] [10.1021/acs.jmedchem.2c00947]

Source