N-(3-imidazol-1-ylpropyl)-4-[1-(2-thienylsulfonyl)indol-3-yl]butanamide

ID: ALA5195657

Cas Number: 2785377-42-4

PubChem CID: 44775165

Max Phase: Preclinical

Molecular Formula: C22H24N4O3S2

Molecular Weight: 456.59

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(CCCc1cn(S(=O)(=O)c2cccs2)c2ccccc12)NCCCn1ccnc1

Standard InChI:  InChI=1S/C22H24N4O3S2/c27-21(24-11-5-13-25-14-12-23-17-25)9-3-6-18-16-26(20-8-2-1-7-19(18)20)31(28,29)22-10-4-15-30-22/h1-2,4,7-8,10,12,14-17H,3,5-6,9,11,13H2,(H,24,27)

Standard InChI Key:  MXMWCTJAZQHXKE-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   -2.1672    0.5083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4528    0.9208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2535   -0.3120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0604   -0.4836    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4728    0.2308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9208    0.8438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2771    0.4023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5323    1.1870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9844    1.7982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1770    1.6316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7384    0.5084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0242    0.9208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6900    0.5084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4043    0.9208    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.6900   -0.3163    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1186    0.5084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8329    0.9208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5471    0.5084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2615    0.9208    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.3476    1.7407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1540    1.9121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5662    1.1982    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.0145    0.5855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4727   -1.1978    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0604   -1.9121    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2976   -1.1978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6480   -1.1978    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7821   -1.8647    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5662   -1.6100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5662   -0.7856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7821   -0.5309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  1  2  0
  3  4  1  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  8  7  2  0
  9  8  1  0
 10  9  2  0
  6 10  1  0
  2 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 13 15  2  0
 14 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 20 19  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 19  1  0
  4 24  1  0
 24 25  2  0
 24 26  1  0
 24 27  2  0
 28 26  1  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 26  2  0
M  END

Associated Targets(Human)

IDE Tchem Insulin-degrading enzyme (806 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 456.59Molecular Weight (Monoisotopic): 456.1290AlogP: 3.67#Rotatable Bonds: 10
Polar Surface Area: 85.99Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 6.79CX LogP: 2.86CX LogD: 2.79
Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.37Np Likeness Score: -1.76

References

1. Kraupner N, Dinh CP, Wen X, Landry V, Herledan A, Leroux F, Bosc D, Charton J, Maillard C, Warenghem S, Duplan I, Piveteau C, Hennuyer N, Staels B, Deprez B, Deprez-Poulain R..  (2022)  Identification of indole-based activators of insulin degrading enzyme.,  228  [PMID:34815130] [10.1016/j.ejmech.2021.113982]

Source