The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2R)-3-[1-(benzenesulfonyl)indol-3-yl]-2-(tert-butoxycarbonylamino)propanoic acid ID: ALA5195702
PubChem CID: 58594906
Max Phase: Preclinical
Molecular Formula: C22H24N2O6S
Molecular Weight: 444.51
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(C)OC(=O)N[C@H](Cc1cn(S(=O)(=O)c2ccccc2)c2ccccc12)C(=O)O
Standard InChI: InChI=1S/C22H24N2O6S/c1-22(2,3)30-21(27)23-18(20(25)26)13-15-14-24(19-12-8-7-11-17(15)19)31(28,29)16-9-5-4-6-10-16/h4-12,14,18H,13H2,1-3H3,(H,23,27)(H,25,26)/t18-/m1/s1
Standard InChI Key: MMYMUXDNQPGHRR-GOSISDBHSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
1.8646 -0.9982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3985 -0.1907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4084 -0.0192 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.8209 -0.7336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2688 -1.3467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8805 -1.6900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6253 -0.9052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3326 -2.3012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5251 -2.1346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8208 0.6951 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-0.4084 1.4094 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0039 0.6951 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.0584 1.4093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6457 0.6951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8808 1.4086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2933 0.6940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8843 -0.0175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0599 -0.0222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4847 -1.0112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1502 -1.4106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2591 -0.9702 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5447 -1.3826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5447 -2.2075 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8646 -0.1733 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5790 0.2390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5790 1.0639 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2933 -0.1733 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8646 1.4763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8646 2.3012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1502 1.0639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1502 1.8888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 4 1 0
4 5 2 0
6 7 2 0
4 7 1 0
8 6 1 0
9 8 2 0
5 9 1 0
3 10 1 0
10 11 2 0
10 12 2 0
13 14 2 0
14 10 1 0
15 13 1 0
16 15 2 0
17 16 1 0
14 18 1 0
18 17 2 0
2 19 2 0
5 19 1 0
19 20 1 0
20 1 1 0
21 22 1 0
22 1 1 0
22 23 2 0
1 24 1 1
24 25 1 0
25 26 1 0
25 27 2 0
26 28 1 0
28 29 1 0
28 30 1 0
28 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 444.51Molecular Weight (Monoisotopic): 444.1355AlogP: 3.40#Rotatable Bonds: 6Polar Surface Area: 114.70Molecular Species: ACIDHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.36CX Basic pKa: ┄CX LogP: 3.60CX LogD: 0.19Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.60Np Likeness Score: -0.80
References 1. Kraupner N, Dinh CP, Wen X, Landry V, Herledan A, Leroux F, Bosc D, Charton J, Maillard C, Warenghem S, Duplan I, Piveteau C, Hennuyer N, Staels B, Deprez B, Deprez-Poulain R.. (2022) Identification of indole-based activators of insulin degrading enzyme., 228 [PMID:34815130 ] [10.1016/j.ejmech.2021.113982 ]