The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-(5-(4-(2-(piperidin-1-yl)ethoxy)phenyl)-1H-benzoimidazol-1-yl)phenyl)acetamide ID: ALA5196221
PubChem CID: 163322395
Max Phase: Preclinical
Molecular Formula: C28H30N4O2
Molecular Weight: 454.57
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)Nc1ccc(-n2cnc3cc(-c4ccc(OCCN5CCCCC5)cc4)ccc32)cc1
Standard InChI: InChI=1S/C28H30N4O2/c1-21(33)30-24-8-10-25(11-9-24)32-20-29-27-19-23(7-14-28(27)32)22-5-12-26(13-6-22)34-18-17-31-15-3-2-4-16-31/h5-14,19-20H,2-4,15-18H2,1H3,(H,30,33)
Standard InChI Key: GAXVYKWKQSGVIF-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
-4.0665 -2.9643 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.7864 -3.3673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4980 -2.9495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4980 -2.1287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7769 -1.7214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0665 -2.1392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3586 -3.3799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6448 -2.9747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9370 -3.3903 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2232 -2.9850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2232 -2.1643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5038 -1.7559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2083 -2.1726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2083 -2.9977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5109 -3.4017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9203 -1.7642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6328 -2.1811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3453 -1.7642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3453 -0.9375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6328 -0.5299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9203 -0.9387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1315 -0.6821 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.6174 -1.3509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1315 -2.0196 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.3851 0.0986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8367 0.7093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0869 1.4911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8938 1.6639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4504 1.0549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1919 0.2713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1439 2.4457 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.9461 2.6199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1961 3.4017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4980 2.0123 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
1 6 1 0
1 7 1 0
8 7 1 0
8 9 1 0
9 10 1 0
11 10 2 0
12 11 1 0
13 12 2 0
13 14 1 0
10 15 1 0
15 14 2 0
13 16 1 0
17 16 2 0
18 17 1 0
18 19 2 0
19 20 1 0
16 21 1 0
21 20 2 0
19 22 1 0
22 23 1 0
23 24 2 0
18 24 1 0
22 25 1 0
26 25 2 0
27 26 1 0
28 27 2 0
28 29 1 0
25 30 1 0
30 29 2 0
28 31 1 0
32 31 1 0
32 33 1 0
32 34 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 454.57Molecular Weight (Monoisotopic): 454.2369AlogP: 5.52#Rotatable Bonds: 7Polar Surface Area: 59.39Molecular Species: BASEHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 8.83CX LogP: 4.74CX LogD: 3.29Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.40Np Likeness Score: -1.48
References 1. Dokla EME, Abdel-Aziz AK, Milik SN, McPhillie MJ, Minucci S, Abouzid KAM.. (2022) Discovery of a benzimidazole-based dual FLT3/TrKA inhibitor targeting acute myeloid leukemia., 56 [PMID:35033885 ] [10.1016/j.bmc.2021.116596 ]