N-[2-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]-5-(trifluoromethyl)phenyl]-5-(4-pyridyl)furan-2-carboxamide

ID: ALA5196246

PubChem CID: 73672854

Max Phase: Preclinical

Molecular Formula: C25H28F3N5O2

Molecular Weight: 487.53

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN(C)CCN1CCN(c2ccc(C(F)(F)F)cc2NC(=O)c2ccc(-c3ccncc3)o2)CC1

Standard InChI:  InChI=1S/C25H28F3N5O2/c1-31(2)11-12-32-13-15-33(16-14-32)21-4-3-19(25(26,27)28)17-20(21)30-24(34)23-6-5-22(35-23)18-7-9-29-10-8-18/h3-10,17H,11-16H2,1-2H3,(H,30,34)

Standard InChI Key:  ALLIMXLDTJFWHR-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   -1.5310    0.2066    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8165    0.6192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8165    1.4444    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1018    0.2065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0156   -0.6137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7912   -0.7852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2036   -0.0709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6516    0.5420    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0284   -0.0709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4410    0.6432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2632    0.6424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6758   -0.0720    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2668   -0.7834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4425   -0.7882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2453    0.6190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9597    0.2069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6714    0.6186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6714    1.4436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9615    1.8553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2453    1.4473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9597   -0.6179    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2454   -1.0302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2454   -1.8549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9597   -2.2673    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6739   -1.8549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6739   -1.0302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9597   -3.0921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2454   -3.5044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5310   -3.0922    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9615    2.6801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6758    3.0924    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2472    3.0924    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9615    3.5048    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8169   -3.5048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5310   -2.2675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  2  4  1  0
  5  4  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  4  1  0
  7  9  1  0
 10  9  2  0
 11 10  1  0
 12 11  2  0
 13 12  1  0
 14 13  2  0
  9 14  1  0
  1 15  1  0
 16 15  2  0
 17 16  1  0
 18 17  2  0
 19 18  1  0
 20 19  2  0
 15 20  1  0
 16 21  1  0
 22 21  1  0
 23 22  1  0
 24 23  1  0
 25 24  1  0
 26 25  1  0
 21 26  1  0
 24 27  1  0
 27 28  1  0
 29 28  1  0
 19 30  1  0
 30 31  1  0
 30 32  1  0
 30 33  1  0
 29 34  1  0
 29 35  1  0
M  END

Alternative Forms

  1. Parent:

Associated Targets(Human)

SRPK1 Tchem Serine/threonine-protein kinase SRPK1 (2359 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 487.53Molecular Weight (Monoisotopic): 487.2195AlogP: 4.30#Rotatable Bonds: 7
Polar Surface Area: 64.85Molecular Species: BASEHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.69CX Basic pKa: 8.74CX LogP: 3.33CX LogD: 1.97
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.54Np Likeness Score: -1.96

References

1. Tang J, Xie Y, Huang J, Zhang L, Jiang W, Li Z, Bian J..  (2022)  A critical update on the strategies towards small molecule inhibitors targeting Serine/arginine-rich (SR) proteins and Serine/arginine-rich proteins related kinases in alternative splicing.,  70  [PMID:35863237] [10.1016/j.bmc.2022.116921]

Source