The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-[2-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]-5-(trifluoromethyl)phenyl]-5-(4-pyridyl)furan-2-carboxamide ID: ALA5196246
PubChem CID: 73672854
Max Phase: Preclinical
Molecular Formula: C25H28F3N5O2
Molecular Weight: 487.53
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)CCN1CCN(c2ccc(C(F)(F)F)cc2NC(=O)c2ccc(-c3ccncc3)o2)CC1
Standard InChI: InChI=1S/C25H28F3N5O2/c1-31(2)11-12-32-13-15-33(16-14-32)21-4-3-19(25(26,27)28)17-20(21)30-24(34)23-6-5-22(35-23)18-7-9-29-10-8-18/h3-10,17H,11-16H2,1-2H3,(H,30,34)
Standard InChI Key: ALLIMXLDTJFWHR-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
-1.5310 0.2066 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.8165 0.6192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8165 1.4444 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.1018 0.2065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0156 -0.6137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7912 -0.7852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2036 -0.0709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6516 0.5420 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0284 -0.0709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4410 0.6432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2632 0.6424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6758 -0.0720 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2668 -0.7834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4425 -0.7882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2453 0.6190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9597 0.2069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6714 0.6186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6714 1.4436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9615 1.8553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2453 1.4473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9597 -0.6179 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.2454 -1.0302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2454 -1.8549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9597 -2.2673 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.6739 -1.8549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6739 -1.0302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9597 -3.0921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2454 -3.5044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5310 -3.0922 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.9615 2.6801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6758 3.0924 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.2472 3.0924 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.9615 3.5048 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.8169 -3.5048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5310 -2.2675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
2 4 1 0
5 4 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 4 1 0
7 9 1 0
10 9 2 0
11 10 1 0
12 11 2 0
13 12 1 0
14 13 2 0
9 14 1 0
1 15 1 0
16 15 2 0
17 16 1 0
18 17 2 0
19 18 1 0
20 19 2 0
15 20 1 0
16 21 1 0
22 21 1 0
23 22 1 0
24 23 1 0
25 24 1 0
26 25 1 0
21 26 1 0
24 27 1 0
27 28 1 0
29 28 1 0
19 30 1 0
30 31 1 0
30 32 1 0
30 33 1 0
29 34 1 0
29 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 487.53Molecular Weight (Monoisotopic): 487.2195AlogP: 4.30#Rotatable Bonds: 7Polar Surface Area: 64.85Molecular Species: BASEHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.69CX Basic pKa: 8.74CX LogP: 3.33CX LogD: 1.97Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.54Np Likeness Score: -1.96
References 1. Tang J, Xie Y, Huang J, Zhang L, Jiang W, Li Z, Bian J.. (2022) A critical update on the strategies towards small molecule inhibitors targeting Serine/arginine-rich (SR) proteins and Serine/arginine-rich proteins related kinases in alternative splicing., 70 [PMID:35863237 ] [10.1016/j.bmc.2022.116921 ]